Compound Summary
TANNIC ACID
Compound Information
TANNIC ACID
Compound Name: | TANNIC ACID |
Compound CID: | 16129778 |
Synonyms: | TANNIC ACID 1401-55-4 Gallotannin Glycerite Chinese gallotannin More... |
Iupac Name: | [2,3-dihydroxy-5-[[(2R,3R,4S,5R,6S)-3,4,5,6-tetrakis[[3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoyl]oxy]oxan-2-yl]methoxycarbonyl]phenyl] 3,4,5-trihydroxybenzoate |
InChI: | InChI=1S/C76H52O46/c77-32-1-22(2-33(78)53(32)92)67(103)113-47-16-27(11-42(87)58(47)97)66(102)112-21-52-63(119-72(108)28-12-43(88)59(98)48(17-28)114-68(104)23-3-34(79)54(93)35(80)4-23)64(120-73(109)29-13-44(89)60(99)49(18-29)115-69(105)24-5-36(81)55(94)37(82)6-24)65(121-74(110)30-14-45(90)61(100)50(19-30)116-70(106)25-7-38(83)56(95)39(84)8-25)76(118-52)122-75(111)31-15-46(91)62(101)51(20-31)117-71(107)26-9-40(85)57(96)41(86)10-26/h1-20,52,63-65,76-101H,21H2/t52-,63-,64+,65-,76+/m1/s1 |
InChIKey: | LRBQNJMCXXYXIU-PPKXGCFTSA-N |
Canonical Smiles: | C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)O |
Isomeric Smiles: | C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OC[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)O |
Molecular Weight: | 1701.2 |
Molecular Formula: | C76H52O46 |
Compound Structure
2D Structure:
3D Structure:
Computed Properties
TANNIC ACID
Molecular Weight: | 1701.2 |
Molecular Formula: | C76H52O46 |
Hydrogen Bond Donor Count: | 25 |
Hydrogen Bond Acceptor Count: | 46 |
Rotatable Bond Count: | 31 |
Heavy Atom Count: | 122 |
Complexity: | 3570 |
Synonyms
TANNIC ACID
| TANNIC ACID | TANNIC ACID |
|---|---|
TANNIC ACID |
1401-55-4 |
Gallotannin |
Glycerite |
Chinese gallotannin |
Gallotannic acid |
5424-20-4 |
MFCD00066397 |
MLS001335996 |
CHEBI:81066 |
2,3-dihydroxy-5-(2R,3R,4S,5R,6S)-3,4,5,6-tetrakis3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoyloxyoxan-2-ylmethoxycarbonylphenyl 3,4,5-trihydroxybenzoate |
SMR000857330 |
DSSTox_CID_6076 |
DSSTox_RID_78006 |
DSSTox_GSID_26076 |
2,3-Dihydroxy-5-3,4,5,6-tetrakis3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoyloxyoxan-2-ylmethoxycarbonylphenyl 3,4,5-trihydroxybenzoate |
FEMA No. 3042 |
Quebracho extract |
CAS-1401-55-4 |
C76H52O46 |
tannic-acid |
NSC656273 |
NSC-656273 |
NCGC00095101-01 |
EINECS 226-562-9 |
Tannin (Tannic acid) |
Tannic acid, technical |
Tannic acid, ACS reagent |
Tannic acid, technical grade |
MLS001335995 |
SCHEMBL409692 |
Tannic acid, SAJ first grade |
CHEMBL506247 |
GTPL4319 |
BDBM60986 |
DTXSID00892987 |
Tannic acid, puriss., 95.0% |
cid_16129778 |
Tox21_111422 |
Tox21_300079 |
BDBM50442879 |
s3951 |
AKOS015951319 |
Tannic acid, Vetec(TM) reagent grade |
CCG-270692 |
beta-D-Glucose pentakis(3,4-dihydroxy-5-((3,4,5-trihydroxybenzoyl)oxy)benzoate) |
NCGC00186054-01 |
NCGC00186054-02 |
NCGC00253925-01 |
Tannic acid, tested according to Ph.Eur. |
C17409 |
Tannic acid, Source: Chinese natural gall nuts |
A901485 |
Q427956 |
Q-201780 |
Tannic acid, puriss., meets analytical specification of USP, powder |
Tannic acid, United States Pharmacopeia (USP) Reference Standard |
.Beta.-D-glucopyranose, pentakis3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoate |
beta-D-Glucopyranose pentakis3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoate |
(2R,3R,4S,5R,6S)-4,5,6-tris({3,4-dihydroxy-5-(3,4,5-trihydroxyphenyl)carbonyloxyphenyl}carbonyloxy)-2-({3,4-dihydroxy-5-(3,4,5-trihydroxyphenyl)carbonyloxyphenyl}carbonyloxy)methyloxan-3-yl 3,4-dihydroxy-5-(3,4,5-trihydroxyphenyl)carbonyloxybenzoate |
2,3-dihydroxy-5-(2R,3R,4S,5R,6S)-3,4,5,6-tetrakis3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxy-benzoyloxytetrahydropyran-2-ylmethoxycarbonylphenyl 3,4,5-trihydroxybenzoate |
Experimental Data
TANNIC ACID
| Species | Dose | Unit | Control(Avg days) | Treatment(Avg days) | Avg/Med Lifespan Change(%) | Control(Max days) | Treatment(Max days) | Max Lifespan Change(%) | Significant | Strain | Gender | PubMed | Avg/Med Lifespan Change tab |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Caenorhabditis elegans | 200.000000000000000 | umol/L | S | N2 | 33683565 | ||||||||
| Caenorhabditis elegans | 400.000000000000000 | umol/L | S | N2 | 33683565 | ||||||||
| Caenorhabditis elegans | 50.000000000000000 | umol/L | S | N2 | 33683565 | ||||||||
| Caenorhabditis elegans | 25.000000000000000 | umol/L | S | N2 | 33683565 | ||||||||
| Caenorhabditis elegans | 300.000000000000000 | umol/L | NS | N2 | 33683565 | Inactive | |||||||
| Caenorhabditis elegans | 100.000000000000000 | umol/L | 15.420000000000000 | 18.080000000000000 | 0.170000000000000 | 16.040000000000000 | 18.860000000000000 | 0.180000000000000 | S | N2 | 20413530 | Active | |
| Caenorhabditis elegans | 100.000000000000000 | umol/L | 17.600000000000000 | S | N2 | 33683565 | Active | ||||||
| Caenorhabditis elegans | 200.000000000000000 | umol/L | 14.460000000000000 | 16.080000000000000 | 0.110000000000000 | 15.480000000000000 | 16.930000000000000 | 0.090000000000000 | S | N2 | 20413530 | Active | |
| Drosophila melanogaster | 1.000000000000000 | mg/mL | 0.000000000000000 | Unclear | Oregon-R | MALES | 8326745 | ||||||
| Caenorhabditis elegans | 100.000000000000000 | umol/L | 19.060000000000000 | S | N2 | 33683565 | Active | ||||||
| Drosophila melanogaster | 1.000000000000000 | mg/mL | -2.900000000000000 | Unclear | Oregon-R | MALES | 8326745 | Inactive | |||||
| Caenorhabditis elegans | 50.000000000000000 | umol/L | 15.350000000000000 | 18.000000000000000 | 0.170000000000000 | 15.920000000000000 | 18.460000000000000 | 0.160000000000000 | S | N2 | 20413530 | Active | |
| Caenorhabditis elegans | 25.000000000000000 | umol/L | 15.350000000000000 | 16.530000000000000 | 0.080000000000000 | 15.920000000000000 | 17.520000000000000 | 0.100000000000000 | S | N2 | 20413530 | Active | |
| Caenorhabditis elegans | 300.000000000000000 | umol/L | 13.760000000000000 | 14.060000000000000 | 0.020000000000000 | 14.690000000000000 | 14.550000000000000 | -0.010000000000000 | NS | N2 | 20413530 | Inactive | |
| Caenorhabditis elegans | 300.000000000000000 | umol/L | -0.920000000000000 | NS | N2 | 33683565 | Inactive | ||||||
| Caenorhabditis elegans | 100.000000000000000 | umol/L | 47.200000000000000 | S | N2 | 33683565 | Active | ||||||
| Caenorhabditis elegans | 200.000000000000000 | umol/L | 8.000000000000000 | S | N2 | 22493606 | Active | ||||||
| Caenorhabditis elegans | 400.000000000000000 | umol/L | 16.410000000000000 | 14.770000000000000 | -0.100000000000000 | 16.630000000000000 | 14.860000000000000 | -0.110000000000000 | S | N2 | 20413530 | Inactive | |
| Caenorhabditis elegans | 0.010000000000000 | % | 21.310000000000000 | 26.600000000000000 | 0.250000000000000 | 27.000000000000000 | 43.000000000000000 | 0.590000000000000 | S | N2 | 22114686 | Active | |
| Caenorhabditis elegans | 400.000000000000000 | umol/L | -10.510000000000000 | S | N2 | 33683565 | Inactive | ||||||
| Caenorhabditis elegans | 100.000000000000000 | umol/L | 7.930000000000000 | S | N2 | 33683565 | Active | ||||||
| Caenorhabditis elegans | 100.000000000000000 | umol/L | 20.890000000000000 | 24.520000000000000 | 0.170000000000000 | 20.500000000000000 | 24.600000000000000 | 0.200000000000000 | S | N2 | 20413530 | Active | |
| Caenorhabditis elegans | 100.000000000000000 | umol/L | 18.000000000000000 | S | N2 | 22493606 | Active | ||||||
| Caenorhabditis elegans | 100.000000000000000 | umol/L | 26.290000000000000 | 30.880000000000000 | 0.170000000000000 | 25.300000000000000 | 30.130000000000000 | 0.190000000000000 | S | N2 | 20413530 | Active | |
| Caenorhabditis elegans | 25.000000000000000 | umol/L | 10.260000000000000 | S | N2 | 33683565 | Active | ||||||
| Caenorhabditis elegans | 100.000000000000000 | umol/L | 9.350000000000000 | 15.780000000000000 | 0.690000000000000 | 10.500000000000000 | 15.450000000000000 | 0.470000000000000 | S | N2 | 20413530 | Active | |
| Drosophila melanogaster | 0.100000000000000 | mg/mL | 0.000000000000000 | Unclear | Oregon-R | MALES | 8326745 | ||||||
| Caenorhabditis elegans | 100.000000000000000 | umol/L | 26.290000000000000 | 27.250000000000000 | 0.040000000000000 | 25.300000000000000 | 26.980000000000000 | 0.070000000000000 | NS | N2 | 20413530 | Inactive | |
| Caenorhabditis elegans | 100.000000000000000 | umol/L | 6.570000000000000 | NS | N2 | 33683565 | Inactive | ||||||
| Caenorhabditis elegans | 100.000000000000000 | umol/L | 20.380000000000000 | S | N2 | 33683565 | Active | ||||||
| Caenorhabditis elegans | 200.000000000000000 | umol/L | 8.350000000000000 | S | N2 | 33683565 | Active | ||||||
| Caenorhabditis elegans | 100.000000000000000 | umol/L | 17.610000000000000 | S | N2 | 33683565 | Active | ||||||
| Caenorhabditis elegans | 50.000000000000000 | umol/L | 16.170000000000000 | S | N2 | 33683565 | Active | ||||||
| Caenorhabditis elegans | 100.000000000000000 | umol/L | 14.460000000000000 | 15.930000000000000 | 0.100000000000000 | 15.270000000000000 | 16.490000000000000 | 0.080000000000000 | S | N2 | 20413530 | Active |
Experimental Data Visualization
TANNIC ACID
Statistics Data
TANNIC ACID
| Species | Avg/Med Lifespan Change(%) | Max Lifespan Change(%) | Count Reference | Count Data point |
|---|---|---|---|---|
| Caenorhabditis elegans | 47.200000000000000 | 0.590000000000000 | 4 | 31 |
| Drosophila melanogaster | 0.000000000000000 | 1 | 3 |
Statistics Data Visualization
TANNIC ACID
