Compound Summary
Compound Name: | 			D-Sorbitol | 
Compound CID: | 			5780 | 
Synonyms: | 			D-Sorbitol sorbitol D-Glucitol 50-70-4 glucitol More... | 
Iupac Name: | 			(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol | 
InChI: | 					InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6-/m1/s1 | 
InChIKey: | 				FBPFZTCFMRRESA-JGWLITMVSA-N | 
Canonical Smiles: | 		C(C(C(C(C(CO)O)O)O)O)O | 
Isomeric Smiles: | 			C([C@H]([C@H]([C@@H]([C@H](CO)O)O)O)O)O | 
Molecular Weight: | 		182.17 | 
Molecular Formula: | 			C6H14O6 | 
Molecular Weight: | 		182.17 | 
Molecular Formula: | 			C6H14O6 | 
Hydrogen Bond Donor Count: | 			6 | 
Hydrogen Bond Acceptor Count: | 			6 | 
Rotatable Bond Count: | 			5 | 
Heavy Atom Count: | 					12 | 
Complexity: | 				105 | 
| D-Sorbitol | D-Sorbitol | 
|---|---|
D-Sorbitol | 			
sorbitol | 
D-Glucitol | 			
50-70-4 | 
glucitol | 			
L-Gulitol | 
(-)-Sorbitol | 			
Glucarine | 
Diakarmon | 			
Multitol | 
Sorbilande | 			
Sorbostyl | 
D-(-)-Sorbitol | 			
Esasorb | 
Karion | 			
Neosorb | 
Nivitin | 			
Siosan | 
Sorbite | 			
Sorbol | 
Cholaxine | 			
Sionit | 
Sionite | 			
Sionon | 
Sorbo | 			
Karion instant | 
Sorbitol F | 			
Sorbex Rp | 
Sorbitol FP | 			
D-Sorbol | 
Sionit K | 			
Sorbex M | 
Sorbex R | 			
Sorbex S | 
Sorbex X | 			
Sorbitol syrup C | 
Hexahydric alcohol | 			
Sorbicolan | 
Sorvilande | 			
Gulitol | 
Neosorb P 60 | 			
D-Sorbite | 
Foodol D 70 | 			
(2R,3R,4R,5S)-Hexane-1,2,3,4,5,6-hexaol | 
Neosorb 20/60DC | 			
Neosorb 70/02 | 
Neosorb 70/70 | 			
Neosorb P 20/60 | 
Karion (carbohydrate) | 			
Probilagol | 
D-1,2,3,4,5,6-Hexanehexol | 			
d-Sorbit | 
FEMA No. 3029 | 			
Sorbitol solutions | 
CCRIS 1898 | 			
Glucitol, D- | 
G-ol | 			
AI3-19424 | 
(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol | 			
HSDB 801 | 
iso-sorbide | 			
Glc-ol | 
NSC 25944 | 			
UNII-506T60A25R | 
CHEBI:17924 | 			
D-Glucitol, homopolymer | 
MFCD00004708 | 			
Resulax | 
Sorbilax | 			
506T60A25R | 
1,2,3,4,5,6-Hexanehexol | 			
E420 | 
Medevac | 			
E 420 | 
DSSTox_CID_3588 | 			
DSSTox_RID_77095 | 
DSSTox_GSID_23588 | 			
Sorbitur | 
(2S,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol | 			
Sorbit DP | 
CAS-50-70-4 | 			
123236-29-3 | 
SMR000112219 | 			
Sorbitol USP:NF | 
Sorbitol 3% in plastic container | 			
WURCS=2.0/1,1,0/h2122h/1/ | 
EINECS 200-061-5 | 			
Solbitol | 
SORBITOL 3.3% IN PLASTIC CONTAINER | 			
NSC-25944 | 
Sorbitol S | 			
Sorbitol FK | 
Sorbit D-Powder | 			
Sorbit S | 
Sorbit W-Powder | 			
Sorbit WP | 
Sorbitol (NF) | 			
Neosorb P60 | 
Sorbitol F solution | 			
Kyowa Powder 50M | 
Sorbogem 712 | 			
Sorbitol (Glucitol) | 
Neosorb P 60W | 			
Sorbit D 70 | 
Sorbit DP 50 | 			
Sorbit L 70 | 
Sorbit T 70 | 			
Sorbit W 70 | 
D-Sorbitol, 99% | 			
Sorbit W-Powder 50 | 
D-2-2HGlucitol | 			
D-sorbitol; D-glucitol | 
D-Sorbitol (JP17) | 			
Sorbitol solution (USP) | 
D-Sorbitol, >=98% | 			
SCHEMBL763 | 
Sorbit Kyowa Powder 50M | 			
bmse000115 | 
bmse000803 | 			
bmse001007 | 
Epitope ID:114708 | 			
Isomalt impurity, sorbitol- | 
D-Sorbitol, NF/FCC grade | 			
CHEMBL1682 | 
MLS001333209 | 			
MLS001333210 | 
D-Sorbitol, analytical standard | 			
D-Sorbitol, for electrophoresis | 
DTXSID5023588 | 			
D-Sorbitol, BioXtra, >=98% | 
D-Sorbitol, for synthesis, 99% | 			
HMS2094K21 | 
HMS2270A18 | 			
Pharmakon1600-01300028 | 
HY-B0400 | 			
Tox21_201937 | 
Tox21_303388 | 			
D-Sorbitol, >=98%, FCC, FG | 
NSC759608 | 			
s2393 | 
ZINC18279893 | 			
AKOS015899604 | 
D-Sorbitol, plant cell culture tested | 			
7B5697N | 
CCG-229392 | 			
D-Sorbit 1000 microg/mL in Methanol | 
DB01638 | 			
NSC-759608 | 
Sorbitol 3% in plastic container (TN) | 			
D-Sorbitol solution, 70% in H2O, CP | 
NCGC00164353-01 | 			
NCGC00164353-02 | 
NCGC00164353-03 | 			
NCGC00257447-01 | 
NCGC00259486-01 | 			
AC-13186 | 
CS-13177 | 			
D-Sorbitol, SAJ first grade, >=97.0% | 
SBI-0206688.P002 | 			
D-Sorbitol, for molecular biology, >=98% | 
D-Sorbitol, BioUltra, >=99.5% (HPLC) | 			
D-Sorbitol, SAJ special grade, >=99.0% | 
D-Sorbitol, Vetec(TM) reagent grade, 97% | 			
E-420 | 
S0065 | 			
SW220289-1 | 
D-Sorbitol, crystallized, >=99.0% (HPLC) | 			
9851-EP2277869A1 | 
9851-EP2280012A2 | 			
9851-EP2281815A1 | 
9851-EP2298776A1 | 			
9851-EP2311818A1 | 
9851-EP2316835A1 | 			
A15606 | 
C00794 | 			
D00096 | 
E70384 | 			
AB00919085_06 | 
D-Sorbitol, liquid, tested according to Ph.Eur. | 			
Q245280 | 
5-(4-Methoxyphenyl)-1,3-Oxazole-4-CarboxylicAcid | 			
mixed with ethyl acetate fraction of Plinia cauliflora | 
mixed with tannin enriched fraction of Plinia cauliflora | 			
Sorbitol, European Pharmacopoeia (EP) Reference Standard | 
UNII-27F77DSJ5V component FBPFZTCFMRRESA-JGWLITMVSA-N | 			
75DE42C3-7C3B-4802-95E0-463F02268BDC | 
Sorbitol, United States Pharmacopeia (USP) Reference Standard | 			
D-Sorbitol, BioReagent, cell culture tested, plant cell culture tested | 
Sorbitol, Pharmaceutical Secondary Standard; Certified Reference Material | 			
Sorbitol F solution, 70 wt. % in H2O, Contains mainly D-sorbitol with lesser amounts of other hydrogenated oligosaccharides | 
| Species | Dose | Unit | Control(Avg days) | Treatment(Avg days) | Avg/Med Lifespan Change(%) | Control(Max days) | Treatment(Max days) | Max Lifespan Change(%) | Significant | Strain | Gender | PubMed | Avg/Med Lifespan Change tab | 
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Caenorhabditis elegans | 2.000000000000000 | % | 20.800000000000000 | 21.900000000000000 | 5.000000000000000 | NS | N2 | 19883616 | Inactive | ||||
| Caenorhabditis elegans | 2.000000000000000 | % | 22.800000000000000 | 22.400000000000000 | -2.000000000000000 | NS | N2 | 19883616 | Inactive | ||||
| Caenorhabditis elegans | 100.000000000000000 | mM | 30.100000000000000 | 28.100000000000000 | -0.070000000000000 | NS | N2 | 26579191 | Inactive | ||||
| Caenorhabditis elegans | 500.000000000000000 | mM | 39.350000000000000 | 57.890000000000000 | S | N2 | 26854551 | Active | |||||
| Caenorhabditis elegans | 137.500000000000000 | mM | 27.400000000000000 | 36.300000000000000 | 0.320000000000000 | S | N2 | 26579191 | Active | ||||
| Caenorhabditis elegans | 5.000000000000000 | mM | 24.000000000000000 | 27.600000000000000 | 0.150000000000000 | S | N2 | 26579191 | Active | ||||
| Caenorhabditis elegans | 5.000000000000000 | mM | 28.900000000000000 | 34.400000000000000 | 0.190000000000000 | S | N2 | 26579191 | Active | ||||
| Caenorhabditis elegans | 5.000000000000000 | mM | 25.700000000000000 | 29.700000000000000 | 0.160000000000000 | S | N2 | 26579191 | Active | ||||
| Caenorhabditis elegans | 55.000000000000000 | mM | 27.400000000000000 | 32.300000000000000 | 0.180000000000000 | S | N2 | 26579191 | Active | ||||
| Caenorhabditis elegans | 250.000000000000000 | mM | 31.200000000000000 | 25.900000000000000 | -0.170000000000000 | S | N2 | 26579191 | Inactive | ||||
| Caenorhabditis elegans | 150.000000000000000 | mM | 25.400000000000000 | 20.700000000000000 | -0.190000000000000 | S | N2 | 26579191 | Inactive | ||||
| Caenorhabditis elegans | 686.000000000000000 | mM | 27.400000000000000 | 31.800000000000000 | 0.160000000000000 | S | N2 | 26579191 | Active | ||||
| Caenorhabditis elegans | 5.000000000000000 | mM | 28.900000000000000 | 35.900000000000000 | 0.240000000000000 | S | N2 | 26579191 | Active | ||||
| Saccharomyces cerevisiae | 1.000000000000000 | M | 29.900000000000000 | S | PSY316 | 12391171 | Active | ||||||
| Caenorhabditis elegans | 500.000000000000000 | mM | 27.400000000000000 | 7.200000000000000 | -0.740000000000000 | S | N2 | 26579191 | Inactive | ||||
| Caenorhabditis elegans | 5.000000000000000 | mM | 24.300000000000000 | 41.100000000000000 | 0.690000000000000 | S | N2 | 26579191 | Active | 
| Species | Avg/Med Lifespan Change(%) | Max Lifespan Change(%) | Count Reference | Count Data point | 
|---|---|---|---|---|
| Caenorhabditis elegans | 39.350000000000000 | 57.890000000000000 | 3 | 15 | 
| Saccharomyces cerevisiae | 29.900000000000000 | 1 | 1 |