Compound Summary
Compound Name: | D-Sorbitol |
Compound CID: | 5780 |
Synonyms: | D-Sorbitol sorbitol D-Glucitol 50-70-4 glucitol More... |
Iupac Name: | (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
InChI: | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6-/m1/s1 |
InChIKey: | FBPFZTCFMRRESA-JGWLITMVSA-N |
Canonical Smiles: | C(C(C(C(C(CO)O)O)O)O)O |
Isomeric Smiles: | C([C@H]([C@H]([C@@H]([C@H](CO)O)O)O)O)O |
Molecular Weight: | 182.17 |
Molecular Formula: | C6H14O6 |
Molecular Weight: | 182.17 |
Molecular Formula: | C6H14O6 |
Hydrogen Bond Donor Count: | 6 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 5 |
Heavy Atom Count: | 12 |
Complexity: | 105 |
D-Sorbitol | D-Sorbitol |
---|---|
D-Sorbitol |
sorbitol |
D-Glucitol |
50-70-4 |
glucitol |
L-Gulitol |
(-)-Sorbitol |
Glucarine |
Diakarmon |
Multitol |
Sorbilande |
Sorbostyl |
D-(-)-Sorbitol |
Esasorb |
Karion |
Neosorb |
Nivitin |
Siosan |
Sorbite |
Sorbol |
Cholaxine |
Sionit |
Sionite |
Sionon |
Sorbo |
Karion instant |
Sorbitol F |
Sorbex Rp |
Sorbitol FP |
D-Sorbol |
Sionit K |
Sorbex M |
Sorbex R |
Sorbex S |
Sorbex X |
Sorbitol syrup C |
Hexahydric alcohol |
Sorbicolan |
Sorvilande |
Gulitol |
Neosorb P 60 |
D-Sorbite |
Foodol D 70 |
(2R,3R,4R,5S)-Hexane-1,2,3,4,5,6-hexaol |
Neosorb 20/60DC |
Neosorb 70/02 |
Neosorb 70/70 |
Neosorb P 20/60 |
Karion (carbohydrate) |
Probilagol |
D-1,2,3,4,5,6-Hexanehexol |
d-Sorbit |
FEMA No. 3029 |
Sorbitol solutions |
CCRIS 1898 |
Glucitol, D- |
G-ol |
AI3-19424 |
(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
HSDB 801 |
iso-sorbide |
Glc-ol |
NSC 25944 |
UNII-506T60A25R |
CHEBI:17924 |
D-Glucitol, homopolymer |
MFCD00004708 |
Resulax |
Sorbilax |
506T60A25R |
1,2,3,4,5,6-Hexanehexol |
E420 |
Medevac |
E 420 |
DSSTox_CID_3588 |
DSSTox_RID_77095 |
DSSTox_GSID_23588 |
Sorbitur |
(2S,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol |
Sorbit DP |
CAS-50-70-4 |
123236-29-3 |
SMR000112219 |
Sorbitol USP:NF |
Sorbitol 3% in plastic container |
WURCS=2.0/1,1,0/h2122h/1/ |
EINECS 200-061-5 |
Solbitol |
SORBITOL 3.3% IN PLASTIC CONTAINER |
NSC-25944 |
Sorbitol S |
Sorbitol FK |
Sorbit D-Powder |
Sorbit S |
Sorbit W-Powder |
Sorbit WP |
Sorbitol (NF) |
Neosorb P60 |
Sorbitol F solution |
Kyowa Powder 50M |
Sorbogem 712 |
Sorbitol (Glucitol) |
Neosorb P 60W |
Sorbit D 70 |
Sorbit DP 50 |
Sorbit L 70 |
Sorbit T 70 |
Sorbit W 70 |
D-Sorbitol, 99% |
Sorbit W-Powder 50 |
D-2-2HGlucitol |
D-sorbitol; D-glucitol |
D-Sorbitol (JP17) |
Sorbitol solution (USP) |
D-Sorbitol, >=98% |
SCHEMBL763 |
Sorbit Kyowa Powder 50M |
bmse000115 |
bmse000803 |
bmse001007 |
Epitope ID:114708 |
Isomalt impurity, sorbitol- |
D-Sorbitol, NF/FCC grade |
CHEMBL1682 |
MLS001333209 |
MLS001333210 |
D-Sorbitol, analytical standard |
D-Sorbitol, for electrophoresis |
DTXSID5023588 |
D-Sorbitol, BioXtra, >=98% |
D-Sorbitol, for synthesis, 99% |
HMS2094K21 |
HMS2270A18 |
Pharmakon1600-01300028 |
HY-B0400 |
Tox21_201937 |
Tox21_303388 |
D-Sorbitol, >=98%, FCC, FG |
NSC759608 |
s2393 |
ZINC18279893 |
AKOS015899604 |
D-Sorbitol, plant cell culture tested |
7B5697N |
CCG-229392 |
D-Sorbit 1000 microg/mL in Methanol |
DB01638 |
NSC-759608 |
Sorbitol 3% in plastic container (TN) |
D-Sorbitol solution, 70% in H2O, CP |
NCGC00164353-01 |
NCGC00164353-02 |
NCGC00164353-03 |
NCGC00257447-01 |
NCGC00259486-01 |
AC-13186 |
CS-13177 |
D-Sorbitol, SAJ first grade, >=97.0% |
SBI-0206688.P002 |
D-Sorbitol, for molecular biology, >=98% |
D-Sorbitol, BioUltra, >=99.5% (HPLC) |
D-Sorbitol, SAJ special grade, >=99.0% |
D-Sorbitol, Vetec(TM) reagent grade, 97% |
E-420 |
S0065 |
SW220289-1 |
D-Sorbitol, crystallized, >=99.0% (HPLC) |
9851-EP2277869A1 |
9851-EP2280012A2 |
9851-EP2281815A1 |
9851-EP2298776A1 |
9851-EP2311818A1 |
9851-EP2316835A1 |
A15606 |
C00794 |
D00096 |
E70384 |
AB00919085_06 |
D-Sorbitol, liquid, tested according to Ph.Eur. |
Q245280 |
5-(4-Methoxyphenyl)-1,3-Oxazole-4-CarboxylicAcid |
mixed with ethyl acetate fraction of Plinia cauliflora |
mixed with tannin enriched fraction of Plinia cauliflora |
Sorbitol, European Pharmacopoeia (EP) Reference Standard |
UNII-27F77DSJ5V component FBPFZTCFMRRESA-JGWLITMVSA-N |
75DE42C3-7C3B-4802-95E0-463F02268BDC |
Sorbitol, United States Pharmacopeia (USP) Reference Standard |
D-Sorbitol, BioReagent, cell culture tested, plant cell culture tested |
Sorbitol, Pharmaceutical Secondary Standard; Certified Reference Material |
Sorbitol F solution, 70 wt. % in H2O, Contains mainly D-sorbitol with lesser amounts of other hydrogenated oligosaccharides |
Species | Dose | Unit | Control(Avg days) | Treatment(Avg days) | Avg/Med Lifespan Change(%) | Control(Max days) | Treatment(Max days) | Max Lifespan Change(%) | Significant | Strain | Gender | PubMed | Avg/Med Lifespan Change tab |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Caenorhabditis elegans | 2.000000000000000 | % | 20.800000000000000 | 21.900000000000000 | 5.000000000000000 | NS | N2 | 19883616 | Inactive | ||||
Caenorhabditis elegans | 2.000000000000000 | % | 22.800000000000000 | 22.400000000000000 | -2.000000000000000 | NS | N2 | 19883616 | Inactive | ||||
Caenorhabditis elegans | 100.000000000000000 | mM | 30.100000000000000 | 28.100000000000000 | -0.070000000000000 | NS | N2 | 26579191 | Inactive | ||||
Caenorhabditis elegans | 500.000000000000000 | mM | 39.350000000000000 | 57.890000000000000 | S | N2 | 26854551 | Active | |||||
Caenorhabditis elegans | 137.500000000000000 | mM | 27.400000000000000 | 36.300000000000000 | 0.320000000000000 | S | N2 | 26579191 | Active | ||||
Caenorhabditis elegans | 5.000000000000000 | mM | 24.000000000000000 | 27.600000000000000 | 0.150000000000000 | S | N2 | 26579191 | Active | ||||
Caenorhabditis elegans | 5.000000000000000 | mM | 28.900000000000000 | 34.400000000000000 | 0.190000000000000 | S | N2 | 26579191 | Active | ||||
Caenorhabditis elegans | 5.000000000000000 | mM | 25.700000000000000 | 29.700000000000000 | 0.160000000000000 | S | N2 | 26579191 | Active | ||||
Caenorhabditis elegans | 55.000000000000000 | mM | 27.400000000000000 | 32.300000000000000 | 0.180000000000000 | S | N2 | 26579191 | Active | ||||
Caenorhabditis elegans | 250.000000000000000 | mM | 31.200000000000000 | 25.900000000000000 | -0.170000000000000 | S | N2 | 26579191 | Inactive | ||||
Caenorhabditis elegans | 150.000000000000000 | mM | 25.400000000000000 | 20.700000000000000 | -0.190000000000000 | S | N2 | 26579191 | Inactive | ||||
Caenorhabditis elegans | 686.000000000000000 | mM | 27.400000000000000 | 31.800000000000000 | 0.160000000000000 | S | N2 | 26579191 | Active | ||||
Caenorhabditis elegans | 5.000000000000000 | mM | 28.900000000000000 | 35.900000000000000 | 0.240000000000000 | S | N2 | 26579191 | Active | ||||
Saccharomyces cerevisiae | 1.000000000000000 | M | 29.900000000000000 | S | PSY316 | 12391171 | Active | ||||||
Caenorhabditis elegans | 500.000000000000000 | mM | 27.400000000000000 | 7.200000000000000 | -0.740000000000000 | S | N2 | 26579191 | Inactive | ||||
Caenorhabditis elegans | 5.000000000000000 | mM | 24.300000000000000 | 41.100000000000000 | 0.690000000000000 | S | N2 | 26579191 | Active |
Species | Avg/Med Lifespan Change(%) | Max Lifespan Change(%) | Count Reference | Count Data point |
---|---|---|---|---|
Caenorhabditis elegans | 39.350000000000000 | 57.890000000000000 | 3 | 15 |
Saccharomyces cerevisiae | 29.900000000000000 | 1 | 1 |