Compound Summary
16423-68-0
Compound Information
16423-68-0
Compound Name: | 16423-68-0 |
Compound CID: | 12961638 |
Synonyms: | 16423-68-0 Erythrosin B Erythrosine B ERYTHROSINE C.I. Acid Red 51 More... |
Iupac Name: | disodium;2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate |
InChI: | InChI=1S/C20H8I4O5.2Na/c21-11-5-9-17(13(23)15(11)25)28-18-10(6-12(22)16(26)14(18)24)20(9)8-4-2-1-3-7(8)19(27)29-20;;/h1-6,25-26H;;/q;2*+1/p-2 |
InChIKey: | RAGZEDHHTPQLAI-UHFFFAOYSA-L |
Canonical Smiles: | C1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C(=C4OC5=C(C(=C(C=C35)I)[O-])I)I)[O-])I.[Na+].[Na+] |
Isomeric Smiles: | C1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C(=C4OC5=C(C(=C(C=C35)I)[O-])I)I)[O-])I.[Na+].[Na+] |
Molecular Weight: | 879.9 |
Molecular Formula: | C20H6I4Na2O5 |
Compound Structure
2D Structure:
3D Structure:
Computed Properties
16423-68-0
Molecular Weight: | 879.9 |
Molecular Formula: | C20H6I4Na2O5 |
Hydrogen Bond Donor Count: | 0 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 0 |
Heavy Atom Count: | 31 |
Complexity: | 645 |
Synonyms
16423-68-0
| 16423-68-0 | 16423-68-0 |
|---|---|
16423-68-0 |
Erythrosin B |
Erythrosine B |
ERYTHROSINE |
C.I. Acid Red 51 |
Erythrosine Lake |
Erythrosin extra bluish |
Sodium 2,4,5,7-tetraiodo-3-oxo-3H-spiroisobenzofuran-1,9-xanthene-3,6-bis(olate) |
Tetraiodofluorescein sodium salt |
Food Red No. 3 |
C.I. Food Red 14 |
FD and C Red No. 3 |
Erythrosine I |
Erythrosine BS |
Erythrosine TB |
Erythrosine 3B |
Maple erythrosine |
Sodium erythrosin |
Erythrosine Extra |
Cilefa Pink B |
Erythrosine Bluish |
Erythrosine B Disodium Salt |
disodium;2,4,5,7-tetraiodo-3-oxospiro2-benzofuran-1,9-xanthene-3,6-diolate |
Dolkwal erythrosine |
Food Dye Red 3 |
Erythrosine TB Extra |
FDC Red 3 dye |
Food Red 14 |
Usacert Red No. 3 |
Calcocid erythrosine N |
Schultz No. 887 |
Hexacert Red No. 3 |
Hexacol erythrosine BS |
FD and C Red 3 |
New Pink Bluish Geigy |
Red Dye No. 3 |
Canacert erythrosine BS |
Erythrosine (indicator) |
Caswell No. 425AB |
FDC Red 3 |
Erythrosine Extra Bluish |
LB-Rot 1 |
Erythrosine Extra Pure A |
D&C Red No. 3 |
Edicol Supra Erythrosin AS |
Edicol Supra Erythrosine A |
Benzoic acid, 2-(6-hydroxy-2,4,5,7-tetraiodo-3-oxo-3H-xanthen-j9-yl)-, disodium salt |
Cerven kysela 51 Czech |
Cerven kysela 51 |
Sodium 2,4,5,7-tetraiodo-3-oxo-3H-spiro-isobenzofuran-1,9-xanthene-3,6-bis(olate) |
CCRIS 892 |
Dye FD and C Red No. 3 |
Erythrosine B (biological stain) |
Cerven potravinarska 14 Czech |
Erythrosine Extra Conc. A Export |
Cerven potravinarska 14 |
EINECS 240-474-8 |
Erythrosine B-FO (biological stain) |
Erythrosine K-FO (biological stain) |
Erythrosine bluish (biological stain) |
EPA Pesticide Chemical Code 120901 |
Erythrosine sodium (close form) USAN |
C20H6I4Na2O5 |
AI3-09094 |
Disodium 2,4,5,7-tetraiodofluorescein |
E 127 |
HSDB 7974 |
2,4,5,7-Tetraiodofluorescein, disodium salt |
Erythrosin B disodium |
Spiro(isobenzofuran-1(3H),9-(9H)xanthen)-3-one, 3,6-dihydroxy-2,4,5,7-tetraiodo-, disodium salt |
CI 45430 |
Disodium 2-(2,4,5,7-tetraiodo-6-oxido-3-oxoxanthen-9-yl)benzoate |
9-(o-Carboxyphenyl)-6-hydroxy-2,4,5,7-tetraiodo-3H-xanthene-3-one disodium salt monohydrate |
Disodium 9-(O-carboxyphenyl)-6-hydroxy-2,4,5,7-tetraiodo-3H-xanthen-3-one monohydrate |
SCHEMBL19080 |
Disodium 3,6-dihydroxy-2,4,5,7-tetraiodospiro(isobenzofuran-1(3H),9-(9H)xanthen)-3-one |
CHEMBL2106219 |
DTXSID7021233 |
Erythrosin B, analytical standard |
BDBM50523756 |
AKOS015904033 |
AKOS016010498 |
NSC 759227 |
3,6-Dihydroxy-2,4,5,7-tetraiodospiro(isobenzofuran-1(3H),9- -(9H)xanthen)-3-one, disodium salt |
Erythrosin extra bluish (C.I. 45430) |
M376 |
Erythrosin extra bluish, 87.0-100.0% |
FT-0625707 |
A16967 |
2-(2,4,5,7-tetraiodo-3-oxido-6-oxoxanthen-9-yl)benzoate |
Erythrosin B disodium 100 microg/mL in Acetonitrile/Water |
Erythrosin extra bluish, certified by the Biological Stain Commission |
Erythrosin B, certified by the Biological Stain Commission, Dye content 90 % |
Erythrosin extra bluish, for microscopy (Bact., Hist.), adsorption and fluorescent indicator |
Sodium 2,4,5,7-tetraiodo-3-oxo-3H-spiroisobenzobfuran-1,9-xanthene-3,6-bis(olate)" |
Experimental Data
16423-68-0
| Species | Dose | Unit | Control(Avg days) | Treatment(Avg days) | Avg/Med Lifespan Change(%) | Control(Max days) | Treatment(Max days) | Max Lifespan Change(%) | Significant | Strain | Gender | PubMed | Avg/Med Lifespan Change tab |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Drosophila melanogaster | 0.000005000000000 | mg/mL | 62.340000000000000 | 49.590000000000000 | -0.200000000000000 | S | 31137639 | Inactive | |||||
| Drosophila melanogaster | 0.005000000000000 | mg/mL | 62.340000000000000 | 50.210000000000000 | -0.190000000000000 | S | 31137639 | Inactive | |||||
| Drosophila melanogaster | 0.000000500000000 | mg/mL | 62.340000000000000 | 55.490000000000000 | -0.110000000000000 | NS | 31137639 | Inactive | |||||
| Drosophila melanogaster | 0.000050000000000 | mg/mL | 62.340000000000000 | 49.850000000000000 | -0.200000000000000 | S | 31137639 | Inactive | |||||
| Drosophila melanogaster | 0.000500000000000 | mg/mL | 62.340000000000000 | 50.010000000000000 | -0.200000000000000 | S | 31137639 | Inactive |
Experimental Data Visualization
16423-68-0
Statistics Data
16423-68-0
| Species | Avg/Med Lifespan Change(%) | Max Lifespan Change(%) | Count Reference | Count Data point |
|---|---|---|---|---|
| Drosophila melanogaster | -0.110000000000000 | 1 | 5 |
Statistics Data Visualization
16423-68-0
