Compound Summary
1,10-Phenanthroline hydrate
Compound Information
1,10-Phenanthroline hydrate
Compound Name: | 1,10-Phenanthroline hydrate |
Compound CID: | 21226 |
Synonyms: | 1,10-Phenanthroline hydrate 5144-89-8 1,10-Phenanthroline monohydrate o-Phenanthroline monohydrate o-Phenanthroline (monohydrate) More... |
Iupac Name: | 1,10-phenanthroline;hydrate |
InChI: | InChI=1S/C12H8N2.H2O/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-8H;1H2 |
InChIKey: | PPQJCISYYXZCAE-UHFFFAOYSA-N |
Canonical Smiles: | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.O |
Isomeric Smiles: | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.O |
Molecular Weight: | 198.22 |
Molecular Formula: | C12H10N2O |
Compound Structure
2D Structure:
3D Structure:
Computed Properties
1,10-Phenanthroline hydrate
Molecular Weight: | 198.22 |
Molecular Formula: | C12H10N2O |
Hydrogen Bond Donor Count: | 1 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 0 |
Heavy Atom Count: | 15 |
Complexity: | 183 |
Synonyms
1,10-Phenanthroline hydrate
| 1,10-Phenanthroline hydrate | 1,10-Phenanthroline hydrate |
|---|---|
1,10-Phenanthroline hydrate |
5144-89-8 |
1,10-Phenanthroline monohydrate |
o-Phenanthroline monohydrate |
o-Phenanthroline (monohydrate) |
1,10-PHENANTHROLINE, MONOHYDRATE |
1, 10-Phenanthroline Monohydrate |
UNII-KSX215X00E |
1,10-phenanthroline;hydrate |
phenanthroline monohydrate |
MFCD00149973 |
KSX215X00E |
1,10-Phenanthroline (monohydrate) |
1,10-Phenanthroline monohydrate, 99% |
4,5-Phenanthroline monohydrate |
AI3-22011 |
1,10-phenanthroline-hydrate |
SCHEMBL44857 |
SCHEMBL3790396 |
1.10-phenanthroline monohydrate |
CHEMBL1255788 |
DTXSID6075302 |
pyridino3,2-hquinoline, hydrate |
AMY25697 |
CS-D1678 |
HY-Y1841 |
STR02839 |
s5543 |
1,10-Phenanthroline monohydrate, ACS |
AKOS015855274 |
CCG-266573 |
FS-2554 |
AB0052586 |
DB-027292 |
FT-0606036 |
FT-0606037 |
ST50825428 |
1,10-Phenanthroline monohydrate, ACS reagent |
1,10-Phenanthroline monohydrate, reagent grade |
A828597 |
1,10-Phenanthroline monohydrate, ACS reagent, 99% |
J-200130 |
J-610049 |
Q20820546 |
1, 10-Phenanthroline monohydrate;Phenanthroline monohydrate |
1,10-Phenanthroline monohydrate, Vetec(TM) reagent grade |
1,10-Phenanthroline monohydrate, JIS special grade, >=99.0% |
1,10-Phenanthroline monohydrate, ACS reagent, puriss. p.a., >=99.5% (calc. to the dried substance), for redox titration |
1,10-Phenanthroline monohydrate, for the spectrophotometric determination of Fe, Pd, V, >=99.0% |
Experimental Data
1,10-Phenanthroline hydrate
| Species | Dose | Unit | Control(Avg days) | Treatment(Avg days) | Avg/Med Lifespan Change(%) | Control(Max days) | Treatment(Max days) | Max Lifespan Change(%) | Significant | Strain | Gender | PubMed | Avg/Med Lifespan Change tab |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Caenorhabditis elegans | 33.000000000000000 | umol/L | -19.000000000000000 | NS | N2 | 24134630 | Inactive |
Experimental Data Visualization
1,10-Phenanthroline hydrate
Statistics Data
1,10-Phenanthroline hydrate
| Species | Avg/Med Lifespan Change(%) | Max Lifespan Change(%) | Count Reference | Count Data point |
|---|---|---|---|---|
| Caenorhabditis elegans | -19.000000000000000 | 1 | 1 |
Statistics Data Visualization
1,10-Phenanthroline hydrate
