Compound Summary
Compound Name: | BranchAmin |
Compound CID: | 9907842 |
Synonyms: | BranchAmin 308062-69-3 UNII-66PZQ62YA6 66PZQ62YA6 Ganlaoqin More... |
Iupac Name: | (2S)-2-amino-3-methylbutanoic acid;(2S)-2-amino-4-methylpentanoic acid;(2S,3S)-2-amino-3-methylpentanoic acid |
InChI: | InChI=1S/2C6H13NO2.C5H11NO2/c1-4(2)3-5(7)6(8)9;1-3-4(2)5(7)6(8)9;1-3(2)4(6)5(7)8/h2*4-5H,3,7H2,1-2H3,(H,8,9);3-4H,6H2,1-2H3,(H,7,8)/t5-;4-,5-;4-/m000/s1 |
InChIKey: | OCUSNPIJIZCRSZ-ZTZWCFDHSA-N |
Canonical Smiles: | CCC(C)C(C(=O)O)N.CC(C)CC(C(=O)O)N.CC(C)C(C(=O)O)N |
Isomeric Smiles: | CC[C@H](C)[C@@H](C(=O)O)N.CC(C)C[C@@H](C(=O)O)N.CC(C)[C@@H](C(=O)O)N |
Molecular Weight: | 379.5 |
Molecular Formula: | C17H37N3O6 |
Molecular Weight: | 379.5 |
Molecular Formula: | C17H37N3O6 |
Hydrogen Bond Donor Count: | 6 |
Hydrogen Bond Acceptor Count: | 9 |
Rotatable Bond Count: | 8 |
Heavy Atom Count: | 26 |
Complexity: | 295 |
| BranchAmin | BranchAmin |
|---|---|
BranchAmin |
308062-69-3 |
UNII-66PZQ62YA6 |
66PZQ62YA6 |
Ganlaoqin |
L-isoleucine compound with L-leucine and L-valine (1:1:1) |
Livact |
Nutramin VL1 |
BACC |
Branched-chain amino acids |
Leucine, isoleucine and valine |
Isoleucine mixture with leucine and valine |
Amino acids, branched-chain |
SCHEMBL138874 |
77431-55-1 |
(2S)-2-amino-3-methylbutanoic acid;(2S)-2-amino-4-methylpentanoic acid;(2S,3S)-2-amino-3-methylpentanoic acid |
| Species | Dosage | Unit | CG Lifespan(AVG/MED days) | TG Lifespan(AVG/MED days) | Lifespan Change(AVG/MED%) | CG Lifespan(MAX days) | TG Lifespan(MAX days) | Lifespan Change(MAX%) | Significant | Strain | Gender | PubMed | Active Label |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Mus musculus | 1.5 | mg/h | 774 | 869 | 12 | 979 | 1043 | 6.5 | S | B6.129S2 | MALES | 20889128 | Active |
| Species | Lifespan Change(AVG/MED%) | Lifespan Change(MAX%) | Count Reference | Count Data point |
|---|---|---|---|---|
| Mus musculus | 12 | 6.5 | 1 | 1 |