Compound Summary
Compound Name: | curcumin |
Compound CID: | 969516 |
Synonyms: | curcumin 458-37-7 Diferuloylmethane Natural yellow 3 Turmeric yellow More... |
Iupac Name: | (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
InChI: | InChI=1S/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-12,24-25H,13H2,1-2H3/b7-3+,8-4+ |
InChIKey: | VFLDPWHFBUODDF-FCXRPNKRSA-N |
Canonical Smiles: | COC1=C(C=CC(=C1)C=CC(=O)CC(=O)C=CC2=CC(=C(C=C2)O)OC)O |
Isomeric Smiles: | COC1=C(C=CC(=C1)/C=C/C(=O)CC(=O)/C=C/C2=CC(=C(C=C2)O)OC)O |
Molecular Weight: | 368.4 |
Molecular Formula: | C21H20O6 |
Molecular Weight: | 368.4 |
Molecular Formula: | C21H20O6 |
Hydrogen Bond Donor Count: | 2 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 8 |
Heavy Atom Count: | 27 |
Complexity: | 507 |
curcumin | curcumin |
---|---|
curcumin |
458-37-7 |
Diferuloylmethane |
Natural yellow 3 |
Turmeric yellow |
Turmeric |
Indian saffron |
Curcuma |
Kacha haldi |
Gelbwurz |
Curcumin I |
Souchet |
Haidr |
Halad |
Haldar |
Halud |
(1E,6E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
Merita earth |
Terra Merita |
Yellow Ginger |
Yellow Root |
Safran dInde |
Yo-Kin |
Curcuma oil |
Golden seal |
Orange Root |
C.I. Natural Yellow 3 |
Curcumine |
Hydrastis |
Indian turmeric |
Yellow puccoon |
Diferaloylmethane |
Turmeric oleoresin |
Kurkumin Czech |
Tumeric yellow |
CI Natural Yellow 3 |
Zlut prirodni 3 Czech |
Cucurmin |
C.I. 75300 |
Tumeric oleoresin |
8024-37-1 |
Curcumin (synthetic) |
E 100 |
Curcurmin |
1,7-Bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
NSC32982 |
UNII-IT942ZTH98 |
MFCD00008365 |
NSC 32982 |
Turmeric (>98% curcurmin) |
CHEBI:3962 |
MLS000069631 |
Turmeric oleoresin (79%-85% curcumin) |
CI 75300 |
Turmeric extract |
Oils, curcuma |
1,9-Bis(4-hydroxy-3-methoxyphenyl)-2,7-nonadiene-4,6-dione |
CHEMBL140 |
(1E,6E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione |
1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (E,E)- |
SMR000058237 |
1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (1E,6E)- |
IT942ZTH98 |
1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione |
Turmeric oil |
Oil of turmeric |
(E,E)-1,7-bis(4-Hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione |
NSC-32982 |
NSC687842 |
Curcuma longa oils |
94875-80-6 |
NCGC00017159-05 |
Kurkumin |
DSSTox_CID_1421 |
(1E,6E)-1,7-bis(4-hydroxy-3-methoxy-phenyl)hepta-1,6-diene-3,5-dione |
(1E,6E)-1,7-bis4-hydroxy-3-(methyloxy)phenylhepta-1,6-diene-3,5-dione |
Zlut prirodni 3 |
Turmeric root oil |
DSSTox_RID_78861 |
DSSTox_GSID_31077 |
Turmeric, oleoresin |
Curcuma oil (Curcuma longa) |
Turmeric oil (Curcuma longa L.) |
Curcuma longa l. root oil |
CAS-458-37-7 |
FEMA No. 3085 |
FEMA No. 3086 |
CCRIS 3257 |
CCRIS 5804 |
HSDB 4334 |
1,5-Di(vanillyliden)acetylaceton |
NCI-C61325 |
SR-01000000149 |
1,5-Divanillyliden-2,4-pentandion |
EINECS 207-280-5 |
NSC 687842 |
BRN 2306965 |
diferuloylmethan |
E 100 (Dye) |
Curcumin solution |
Haldar, Souchet |
Turmeric; Curcuma |
Curcumin,(S) |
trans,trans-Curcumin |
Opera_ID_1627 |
SCHEMBL8440 |
SCHEMBL8441 |
Curcumin, analytical standard |
4-08-00-03697 (Beilstein Handbook Reference) |
MLS001148449 |
BIDD:ER0479 |
CU-01000001305-2 |
turmeric root oil CO2 extract |
cid_969516 |
GTPL7000 |
turmeric root oil hydrodistilled |
DTXSID8031077 |
SCHEMBL13521974 |
BDBM29532 |
cid_5281767 |
cMAP_000052 |
HMS2233K04 |
HMS3649K06 |
ZINC899824 |
2,7-Nonadiene-4,6-dione, 1,9-bis(4-hydroxy-3-methoxyphenyl)- |
91884-86-5 |
AMY33436 |
BCP04695 |
HY-N0005 |
Tox21_110803 |
Tox21_111505 |
Tox21_201116 |
BBL027711 |
BDBM50067040 |
BDBM50140172 |
CC0179 |
CCG-36020 |
CCG-36107 |
SBB006495 |
STL371943 |
AKOS001305497 |
BCP9000557 |
CS-1490 |
curcuma longa l. root oil CO2 extract |
DB11672 |
curcuma longa l. root oil hydrodistilled |
NCGC00017159-04 |
NCGC00017159-06 |
NCGC00017159-07 |
NCGC00017159-09 |
NCGC00017159-10 |
NCGC00017159-11 |
NCGC00017159-12 |
NCGC00023332-03 |
NCGC00023332-04 |
NCGC00023332-05 |
NCGC00258668-01 |
AC-24238 |
AS-72202 |
BP-25396 |
M212 |
ST055629 |
BCP0726000035 |
DB-002681 |
WLN: 1OR BQ E1U1V1V1U1R DQ CO1 |
C-230 |
N1839 |
1,3-Di(3-methoxy-4-hydroxystyryl)propanedial |
1790-EP2305629A1 |
1790-EP2308861A1 |
F21478 |
J10108 |
K00009 |
Curcumin, Curcuma longa L. - CAS 458-37-7 |
Curcumin, from Curcuma longa (Turmeric), powder |
458C377 |
A826902 |
Curcumin, primary pharmaceutical reference standard |
Q312266 |
1,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)- |
SR-01000000149-2 |
SR-01000000149-5 |
BRD-K07572174-001-02-2 |
BRD-K07572174-001-19-6 |
BRD-K07572174-001-22-0 |
Curcumin, >=94% (curcuminoid content), >=80% (Curcumin) |
1,7-bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadien-3,5-dione |
1,7-bis(4-hydroxy-3-methoxyphenyl)1,6-heptadiene-3,5-dione |
Curcumin, (total curcuminoid content), from Turmeric rhizome |
Curcumin, matrix substance for MALDI-MS, >=99.5% (HPLC) |
Curcumin, United States Pharmacopeia (USP) Reference Standard |
1,7-Bis-(4-hydroxy-3-methoxy-phenyl)-hepta-1,6-diene-3,5-dione |
1,7-bis-(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione |
((E,E)-1,7-bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione) |
(1E,6E)-1,7-bis(3-methoxy-4-oxidanyl-phenyl)hepta-1,6-diene-3,5-dione |
(1E,6E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione # |
(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione. |
(1E,6E)-1,7-Bis-(4-hydroxy-3-methoxy-phenyl)-hepta-1,6-diene-3,5-dione |
(1Z,6E)-1,7-Bis-(4-hydroxy-3-methoxy-phenyl)-hepta-1,6-diene-3,5-dione |
1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione, (E,E)- |
5-hydroxy-1,7-bis(4-hydroxy-3-methoxyphenyl)-1,4,6-heptatrien-3-one |
5-Hydroxy-1,7-bis-(4-hydroxy-3-methoxy-phenyl)-hepta-1,4,6-trien-3-one |
Curcumin; 1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione |
(1E,4Z,6E)-5-Hydroxy-1,7-bis-(4-hydroxy-3-methoxy-phenyl)-hepta-1,4,6-trien-3-one |
(E,E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione (Synthetic) |
Curcumin solution, ~0.1 % (w/v) (in ethanol with 2M HCl (99:1 v/v)), for TLC derivatization |
Species | Dosage | Unit | CG Lifespan(AVG/MED days) | TG Lifespan(AVG/MED days) | Lifespan Change(AVG/MED%) | CG Lifespan(MAX days) | TG Lifespan(MAX days) | Lifespan Change(MAX%) | Significant | Strain | Gender | PubMed | Active Label |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Caenorhabditis elegans | 100 | mM | 15.44 | 17.39 | 12.62 | 18 | 23 | 27.77 | S | N2 | 27810360 | Active | |
Drosophila melanogaster | 200 | mM | 0 | NS | Ra | 23063786 | Inactive | ||||||
Apis mellifera | 1 | ug/mL | 0 | NS | 34580381 | Inactive | |||||||
Drosophila melanogaster | 100 | mM | 0 | S | Ra | 23063786 | Active | ||||||
Drosophila melanogaster | 10 | mM | 0 | NS | Ra | 23063786 | Inactive | ||||||
Apis mellifera | 100 | ug/mL | 0 | S | 34580381 | Active | |||||||
Apis mellifera | 10 | ug/mL | 0 | NS | 34580381 | Inactive | |||||||
Caenorhabditis elegans | 10 | umol/L | Unclear | N2 | 33683565 | ||||||||
Caenorhabditis elegans | 20 | umol/L | Unclear | N2 | 33683565 | ||||||||
Caenorhabditis elegans | 200 | umol/L | Unclear | N2 | 33683565 | ||||||||
Caenorhabditis elegans | 100 | umol/L | Unclear | N2 | 33683565 | ||||||||
Drosophila melanogaster | 0.5 | mg | 30 | 33 | 10 | 58 | 55 | -5.1 | NS | Oregon-R | MALES | 22653297 | Inactive |
Drosophila melanogaster | 100 | umol/L | 19 | S | FEMALES | 20645870 | Active | ||||||
Drosophila melanogaster | 0.2 | mg/g | 35.6 | 38 | 0.07 | 57 | 62 | 0.09 | S | Canton-S | FEMALES | 30488487 | Active |
Drosophila melanogaster | 1 | mg | 23 | 24 | 4.6 | 54 | 61 | 13 | S | Oregon-R | FEMALES | 22653297 | Active |
Caenorhabditis elegans | 20 | umol/L | 15.5 | 16.6 | 0.07 | 27 | 25 | -0.07 | NS | N2 | 31534071 | Inactive | |
Caenorhabditis elegans | 100 | umol/L | 17.08 | 16.24 | -4.893 | NS | N2 | 33008901 | Inactive | ||||
Drosophila melanogaster | 0.2 | mg/g | 36.5 | 37.6 | 0.03 | 61 | 64 | 0.05 | NS | Canton-S | MALES | 30488487 | Inactive |
Drosophila melanogaster | 100 | mM | 46.8 | 38 | S | FEMALES | 26136617 | Active | |||||
Drosophila melanogaster | 1 | mg | 30 | 38 | 26.7 | 58 | 55 | -5.1 | S | Oregon-R | MALES | 22653297 | Active |
Caenorhabditis elegans | 100 | umol/L | 15 | 16 | 6.25 | NS | N2 | 29263362 | Inactive | ||||
Drosophila melanogaster | 0.5 | mg | 23 | 26 | 13 | 54 | 53 | -1.9 | S | Oregon-R | FEMALES | 22653297 | Active |
Drosophila melanogaster | 10 | mM | 27.14 | 32.34 | 0.19 | 57 | 65 | 0.14 | S | Canton-S | 25173182 | Active | |
Drosophila melanogaster | 0.5 | g/L | 51 | 49 | -0.04 | NS | MALES | 33951964 | Inactive | ||||
Drosophila melanogaster | 100 | mM | -23.4 | S | FEMALES | 26136617 | Inactive | ||||||
Drosophila melanogaster | 5 | mM | 27.14 | 27.68 | 0.02 | 57 | 53 | -0.07 | S | Canton-S | 25173182 | Active | |
Caenorhabditis elegans | 20 | umol/L | 20.1 | 25.4 | 0.26 | 30 | 33 | 0.1 | S | N2 | 31534071 | Active | |
Caenorhabditis elegans | 200 | umol/L | 8.4 | 8.8 | 0.05 | NS | N2 | 21855561 | Inactive | ||||
Drosophila melanogaster | 100 | mM | -17 | -3 | S | FEMALES | 26136617 | Inactive | |||||
Drosophila melanogaster | 10 | mM | 33.77 | 45.37 | 0.34 | 76 | 95 | 0.25 | S | Canton-S | 25173182 | Active | |
Drosophila melanogaster | 2 | g/L | 51 | 58 | 0.14 | S | MALES | 33951964 | Active | ||||
Mus musculus | 2000 | kg/mg | 786 | 808 | 0.03 | NS | UM-HET3 | MALES | 22451473 | Inactive | |||
Caenorhabditis elegans | 20 | umol/L | 8.4 | 11.7 | 0.39 | S | N2 | 21855561 | Active | ||||
Caenorhabditis elegans | 10 | umol/L | 16.74 | 15.55 | -7.106 | NS | N2 | 33008901 | Inactive | ||||
Drosophila melanogaster | 5 | mM | 33.77 | 35.67 | 0.06 | 76 | 88 | 0.16 | S | Canton-S | 25173182 | Active | |
Drosophila melanogaster | 25 | mM | 27.14 | 28.21 | 0.04 | 57 | 61 | 0.07 | S | Canton-S | 25173182 | Active | |
Drosophila melanogaster | 250 | umol/L | 16 | S | MALES | 20645870 | Active | ||||||
Drosophila melanogaster | 50 | mM | 33.77 | 34.86 | 0.03 | 76 | 89 | 0.17 | S | Canton-S | 25173182 | Active | |
Caenorhabditis elegans | 100 | umol/L | 22.54 | 15.07 | Unclear | N2 | 33683565 | ||||||
Drosophila melanogaster | 50 | mM | 27.14 | 26.81 | -0.01 | 57 | 59 | 0.04 | S | Canton-S | 25173182 | Inactive | |
Drosophila melanogaster | 100 | mM | 25.5 | 0 | S | FEMALES | 26136617 | Active | |||||
Drosophila melanogaster | 200 | umol/L | 44.8 | 44.81 | 0.01429 | NS | MALES | 33008901 | Inactive | ||||
Drosophila melanogaster | 0.5 | g/L | 61 | 63 | 0.03 | NS | FEMALES | 33951964 | Inactive | ||||
Drosophila melanogaster | 25 | mM | 33.77 | 36.99 | 0.1 | 76 | 95 | 0.25 | S | Canton-S | 25173182 | Active | |
Drosophila melanogaster | 1 | mg | 63.9 | 76.9 | 0.2 | S | Wild 1-A | 23675008 | Active | ||||
Drosophila melanogaster | 20 | umol/L | 45.44 | 46.53 | 2.407 | NS | FEMALES | 33008901 | Inactive | ||||
Caenorhabditis elegans | 0.05 | ug/mL | 11 | 11.5 | 0.05 | 19 | 20 | 0.05 | NS | N2 | 29550283 | Inactive | |
Mus musculus | 2000 | kg/mg | 866 | 905 | 0.05 | NS | UM-HET3 | FEMALES | 22451473 | Inactive | |||
Caenorhabditis elegans | 100 | umol/L | 17.3 | 21.2 | 0.23 | 27.2 | 31.3 | 0.15 | NS | N2 | 25959406 | Inactive | |
Drosophila melanogaster | 1 | g/L | 51 | 52 | 0.02 | NS | MALES | 33951964 | Inactive | ||||
Drosophila melanogaster | 2 | g/L | 61 | 68 | 0.11 | S | FEMALES | 33951964 | Active | ||||
Drosophila melanogaster | 1 | g/L | 61 | 66 | 0.08 | S | FEMALES | 33951964 | Active |
Species | Lifespan Change(AVG/MED%) | Lifespan Change(MAX%) | Count Reference | Count Data point |
---|---|---|---|---|
Apis mellifera | 0 | 1 | 3 | |
Caenorhabditis elegans | 22.54 | 27.77 | 8 | 15 |
Drosophila melanogaster | 46.8 | 38 | 9 | 32 |
Mus musculus | 0.05 | 1 | 2 |