Compound Summary
Compound Information
Ketorolac tromethamine
Compound Name: | Ketorolac tromethamine |
Compound CID: | 84003 |
Synonyms: | Ketorolac tromethamine 74103-07-4 Ketorolac tris salt Toradol Acular More... |
Iupac Name: | 2-amino-2-(hydroxymethyl)propane-1,3-diol;5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
InChI: | InChI=1S/C15H13NO3.C4H11NO3/c17-14(10-4-2-1-3-5-10)13-7-6-12-11(15(18)19)8-9-16(12)13;5-4(1-6,2-7)3-8/h1-7,11H,8-9H2,(H,18,19);6-8H,1-3,5H2 |
InChIKey: | BWHLPLXXIDYSNW-UHFFFAOYSA-N |
Canonical Smiles: | C1CN2C(=CC=C2C(=O)C3=CC=CC=C3)C1C(=O)O.C(C(CO)(CO)N)O |
Isomeric Smiles: | C1CN2C(=CC=C2C(=O)C3=CC=CC=C3)C1C(=O)O.C(C(CO)(CO)N)O |
Molecular Weight: | 376.4 |
Molecular Formula: | C19H24N2O6 |
Compound Structure
2D Structure:
3D Structure:
Computed Properties
Ketorolac tromethamine
Molecular Weight: | 376.4 |
Molecular Formula: | C19H24N2O6 |
Hydrogen Bond Donor Count: | 5 |
Hydrogen Bond Acceptor Count: | 7 |
Rotatable Bond Count: | 6 |
Heavy Atom Count: | 27 |
Complexity: | 430 |
Synonyms
Ketorolac tromethamine
| Ketorolac tromethamine | Ketorolac tromethamine |
|---|---|
Ketorolac tromethamine |
74103-07-4 |
Ketorolac tris salt |
Toradol |
Acular |
Ketorolac (tromethamine salt) |
Ketorolac tromethamine salt |
Acular LS |
Acular PF |
Ketorolac trometamol |
Acuvail |
SPRIX |
Ketorolac (Toradol) |
2-amino-2-(hydroxymethyl)propane-1,3-diol 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
C19H24N2O6 |
Lixidol |
Dolac |
MFCD00887595 |
Syntex |
Toradol (TN) |
(+/-)-5-Benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid tris salt |
2-amino-2-(hydroxymethyl)propane-1,3-diol;5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
Godek |
Acular Preservative Free |
Ketorolac Tromethamine;Ketorolac tris salt;RS37619 tromethamine salt |
CHEBI:6130 |
SMR000058461 |
Tromethamine ketorolac |
SR-01000075948 |
RS-37619 |
Toratex |
Droal |
Tora-Dol |
Ketorolac tromethamine USAN:USP |
Acular (TN) |
BPPC |
Spectrum_001578 |
CPD000058461 |
Ketorolac tromethamine ophthalmic solution |
Prestwick0_000929 |
Prestwick1_000929 |
Prestwick2_000929 |
Prestwick3_000929 |
Spectrum2_001598 |
Spectrum3_001975 |
Spectrum4_000215 |
Spectrum5_001273 |
Ketrolac.Tromethamine Salt |
SCHEMBL5036 |
Lopac0_000676 |
BSPBio_000838 |
BSPBio_003575 |
KBioGR_000849 |
KBioSS_002058 |
(+-)-5-Benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid, compound with 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) |
Ketorolac tromethamine (USP) |
MLS000069689 |
MLS001401455 |
MLS002222310 |
DivK1c_000836 |
SPECTRUM1503925 |
SPBio_001596 |
SPBio_003017 |
BPBio1_000922 |
CHEMBL1201124 |
DTXSID0045597 |
HMS502J18 |
KBio1_000836 |
KBio2_002058 |
KBio2_004626 |
KBio2_007194 |
KBio3_002953 |
ROX-828 |
ROX-888 |
NINDS_000836 |
HMS1570J20 |
HMS1922K22 |
HMS2051P06 |
HMS2093M05 |
HMS2097J20 |
HMS2235N13 |
HMS3262G13 |
HMS3373M06 |
HMS3393P06 |
HMS3655E15 |
HMS3714J20 |
Pharmakon1600-01503925 |
BCP02917 |
HY-B0138 |
(+/-)-Ketorolac Tromethamine Salt |
Tox21_500676 |
CCG-39376 |
CK0012 |
NSC758637 |
s5698 |
AKOS024386301 |
BCP9000811 |
CCG-101006 |
CS-1933 |
LP00676 |
NC00256 |
NSC 758637 |
NSC-758637 |
IDI1_000836 |
NCGC00016159-02 |
NCGC00016159-03 |
NCGC00016159-04 |
NCGC00094036-01 |
NCGC00094036-02 |
NCGC00094036-03 |
NCGC00261361-01 |
1H-Pyrrolizine-1-carboxylic acid, 5-benzoyl-2,3-dihydro, (+-)-, compound with 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) |
AS-15193 |
Ketorolac tris salt;Ketorolac Tromethamine |
O440 |
BCP0726000301 |
Ketorolac tris salt, >=99%, crystalline |
DB-055837 |
EU-0100676 |
FT-0630829 |
K0053 |
ST51037313 |
SW197293-4 |
D00813 |
K 1136 |
M02042 |
103K074 |
A838011 |
SR-01000946595 |
Q-201269 |
SR-01000075948-1 |
SR-01000075948-6 |
SR-01000075948-8 |
SR-01000946595-1 |
Q27107089 |
F0001-2390 |
Ketorolac Trometamol 1.0 mg/ml in Methanol (as free acid) |
Ketorolac trometamol, European Pharmacopoeia (EP) Reference Standard |
Ketorolac Tromethamine, United States Pharmacopeia (USP) Reference Standard |
Ketorolac trometamol for peak identification, European Pharmacopoeia (EP) Reference Standard |
Ketorolac Tromethamine, Pharmaceutical Secondary Standard; Certified Reference Material |
5-(phenylcarbonyl)-2,3-dihydropyrrolizinecarboxylic acid, 2-amino-2-(hydroxyme thyl)propane-1,3-diol |
5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate; 2-hydroxyethyl-bis(hydroxymethyl)ammonium;Ketorolac Tromethamine |
Ketorolac Tris Salt / (+/-)-5-Benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic Acid Tris Salt |
Experimental Data
Ketorolac tromethamine
| Species | Dosage | Unit | CG Lifespan(AVG/MED days) | TG Lifespan(AVG/MED days) | Lifespan Change(AVG/MED%) | CG Lifespan(MAX days) | TG Lifespan(MAX days) | Lifespan Change(MAX%) | Significant | Strain | Gender | PubMed | Active Label |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Caenorhabditis elegans | 33 | umol/L | 0 | NS | N2 | 24134630 | Inactive |
Experimental Data Visualization
Ketorolac tromethamine
Statistics Data
Ketorolac tromethamine
| Species | Lifespan Change(AVG/MED%) | Lifespan Change(MAX%) | Count Reference | Count Data point |
|---|---|---|---|---|
| Caenorhabditis elegans | 0 | 1 | 1 |
Statistics Data Visualization
Ketorolac tromethamine
