Compound Summary
Compound Information
L-tyrosine
Compound Name: | L-tyrosine |
Compound CID: | 6057 |
Synonyms: | L-tyrosine tyrosine 60-18-4 (S)-Tyrosine p-Tyrosine More... |
Iupac Name: | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid |
InChI: | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1 |
InChIKey: | OUYCCCASQSFEME-QMMMGPOBSA-N |
Canonical Smiles: | C1=CC(=CC=C1CC(C(=O)O)N)O |
Isomeric Smiles: | C1=CC(=CC=C1C[C@@H](C(=O)O)N)O |
Molecular Weight: | 181.19 |
Molecular Formula: | C9H11NO3 |
Compound Structure
2D Structure:
3D Structure:
Computed Properties
L-tyrosine
Molecular Weight: | 181.19 |
Molecular Formula: | C9H11NO3 |
Hydrogen Bond Donor Count: | 3 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
Heavy Atom Count: | 13 |
Complexity: | 176 |
Synonyms
L-tyrosine
| L-tyrosine | L-tyrosine |
|---|---|
L-tyrosine |
tyrosine |
60-18-4 |
(S)-Tyrosine |
p-Tyrosine |
L-p-Tyrosine |
H-Tyr-OH |
(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid |
4-Hydroxy-L-phenylalanine |
L-(-)-Tyrosine |
Tyrosinum Latin |
Tyrosine (VAN) |
Tirosina Spanish |
(-)-alpha-Amino-p-hydroxyhydrocinnamic acid |
L-Phenylalanine, 4-hydroxy- |
beta-(p-Hydroxyphenyl)alanine |
Tyrosine USAN:INN |
Tyrosine, L- |
(S)-alpha-Amino-4-hydroxybenzenepropanoic acid |
3-(4-Hydroxyphenyl)-L-alanine |
FEMA No. 3736 |
L-2-Amino-3-p-hydroxyphenylpropanoic acid |
(S)-3-(p-Hydroxyphenyl)alanine |
(S)-(-)-Tyrosine |
HSDB 2003 |
alpha-Amino-beta-(4-hydroxyphenyl)propionic acid |
AI3-09055 |
tirosina |
Propanoic acid, 2-amino-3-(4-hydroxyphenyl)-, (S)- |
NSC 82624 |
L-tyrosinyl radical |
alpha-Amino-p-hydroxyhydrocinnamic acid, (-)- |
L-Tyr |
(S)-2-Amino-3-(4-hydroxyphenyl)propanoic acid |
(S)-2-Amino-3-(p-hydroxyphenyl)propionic acid |
L-Tyrosine, monomer |
alpha-Amino-4-hydroxybenzenepropanoic acid, (S)- |
UNII-42HK56048U |
Benzenepropanoic acid, alpha-amino-4-hydroxy-, (S)- |
MFCD00002606 |
(S)-2-Amino-3-(4-hydroxyphenyl)propionic acid |
2-Amino-3-(4-hydroxyphenyl)propanoic acid, (S)- |
CHEBI:17895 |
42HK56048U |
tyr |
NCGC00159350-02 |
Tyrosine (L-Tyrosine) |
Tyrosinum |
DSSTox_CID_3730 |
L-Tyrosin |
DSSTox_RID_77170 |
DSSTox_GSID_23730 |
L-Tyrosine, homopolymer |
CAS-60-18-4 |
L-Tyrosine (9CI) |
4ts1 |
Tyrosine (USP/INN) |
EINECS 200-460-4 |
plovamer-acetate |
Benzenepropanoate |
NSC-82624 |
2csm |
(L)-Tyrosine |
(-) tyrosine |
25619-78-7 |
H-Tyr |
L-Tyrosine,(S) |
(-)-.alpha.-Amino-p-hydroxyhydrocinnamic acid |
L-Tyrosine (JP17) |
Tyrosine, L- (8CI) |
.alpha.-Amino-.beta.-(4-hydroxyphenyl)propionic acid |
Melanin synthesized from Tyr substrate catalyzed by tyrosinase for 6 hrs |
bmse000051 |
CHEMBL925 |
SCHEMBL1581 |
L-U-14CTyr |
L-Phenylalanine-4-hydroxy- |
L-Tyrosine non-animal source |
Levodopa impurity, l-tyrosine- |
GTPL4791 |
L-Tyrosine, >=97%, FG |
DD69927C-C6A8-4BC6-8E9A-0AB423B176E7 |
DTXSID1023730 |
BDBM18129 |
L-Tyrosine, Cell Culture Reagent |
ZINC266964 |
N-acetyl-o-(dihydroxymethylsilyl)- |
HY-N0473 |
L-Tyrosine, Vetec(TM), 98.5% |
Levodopa related compound l-tyrosine |
Tox21_111594 |
(-)-a-Amino-p-hydroxyhydrocinnamate |
AC2634 |
s4608 |
AKOS010400205 |
Tox21_111594_1 |
(S)-a-Amino-4-hydroxybenzenepropanoate |
AM82304 |
CS-8013 |
DB00135 |
MCULE-2932088896 |
(-)-alpha-Amino-p-hydroxyhydrocinnamate |
(-)-a-Amino-p-hydroxyhydrocinnamic acid |
(S)-a-amino-4-hydroxy-Benzenepropanoate |
NCGC00159350-03 |
NCGC00344525-01 |
AC-11295 |
AS-11772 |
BP-13285 |
Melanin synthesized from Tyr substrate catalyzed by tyrosinase for 6 hrs, oxidized with hydrogen peroxide |
Melanin synthesized from Tyr substrate catalyzed by tyrosinase for 6 hrs, oxidized with hydrogen peroxide, <3 kd fraction |
Melanin synthesized from Tyr substrate catalyzed by tyrosinase, brominated with N-bromosuccinimide |
Melanin synthesized from Tyr substrate catalyzed by tyrosinase, sulfonated using sulfur trioxide/DMF complex for 1.5-7 hours |
(S)-alpha-Amino-4-hydroxybenzenepropanoate |
DIETHYL1,3,5-BENZENETRICARBOXYLATE |
L-Tyrosine, BioUltra, >=99.0% (NT) |
(S)-2-Amino-3-(p-hydroxyphenyl)propionate |
(S)-a-Amino-4-hydroxybenzenepropanoic acid |
AB0010718 |
DB-029987 |
L-Tyrosine, Free Base - CAS 60-18-4 |
(S)-a-amino-4-hydroxy-Benzenepropanoic acid |
(S)-alpha-amino-4-hydroxy-Benzenepropanoate |
L-Tyrosine, reagent grade, >=98% (HPLC) |
L-Tyrosine, SAJ special grade, >=99.0% |
T0550 |
Y9454 |
C00082 |
D00022 |
D70837 |
L-Tyrosine, Vetec(TM) reagent grade, >=98% |
M02963 |
(2S)-2-amino-3-(4-hydroxyphenyl)propanoicacid |
(S)-alpha-amino-4-hydroxy-Benzenepropanoic acid |
88844-EP2289892A1 |
88844-EP2305825A1 |
(S)-.alpha.-Amino-4-hydroxybenzenepropanoic acid |
002T606 |
2-Amino-3-(4-hydroxyphenyl)propanoic acid-(S)- |
A832631 |
Q188017 |
J-521656 |
Propanoic acid, 2-amino-3-(4-hydroxyphenyl)-(S)- |
Q27115106 |
Benzenepropanoic acid, .alpha.-amino-4-hydroxy-, (S)- |
F8889-8713 |
L-Tyrosine, certified reference material, TraceCERT(R) |
Tyrosine, European Pharmacopoeia (EP) Reference Standard |
Z1250208672 |
UNII-0O72R8RF8A component OUYCCCASQSFEME-QMMMGPOBSA-N |
UNII-A9BAT9B32M component OUYCCCASQSFEME-QMMMGPOBSA-N |
UNII-N7U7BXP2OI component OUYCCCASQSFEME-QMMMGPOBSA-N |
L-Tyrosine, United States Pharmacopeia (USP) Reference Standard |
2-amino-3-(4-hydroxyphen yl)-2-amino-3-(4-hydroxyphenyl)-Propanoate |
2-amino-3-(4-hydroxyphen yl)-2-amino-3-(4-hydroxyphenyl)-Propanoic acid |
Benzeneethanaminium, a-carboxy-4-hydroxy-N,N,N-trimethyl-,inner salt, (aS)- |
1189756-47-5 |
L-Tyrosine, from non-animal source, meets EP, USP testing specifications, suitable for cell culture, >=99.0% |
L-Tyrosine, PharmaGrade, Ajinomoto, EP, JP, USP, manufactured under appropriate GMP controls for pharma or biopharmaceutical production, suitable for cell culture |
Experimental Data
L-tyrosine
| Species | Dosage | Unit | CG Lifespan(AVG/MED days) | TG Lifespan(AVG/MED days) | Lifespan Change(AVG/MED%) | CG Lifespan(MAX days) | TG Lifespan(MAX days) | Lifespan Change(MAX%) | Significant | Strain | Gender | PubMed | Active Label |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Caenorhabditis elegans | 1 | mM | Unclear | N2 | 33683565 | ||||||||
| Caenorhabditis elegans | 5 | mM | 5 | S | N2 | 25643626 | Active | ||||||
| Caenorhabditis elegans | 1 | mM | 10 | S | N2 | 25643626 | Active | ||||||
| Caenorhabditis elegans | 10 | mM | 2 | S | N2 | 25643626 | Active |
Experimental Data Visualization
L-tyrosine
Statistics Data
L-tyrosine
| Species | Lifespan Change(AVG/MED%) | Lifespan Change(MAX%) | Count Reference | Count Data point |
|---|---|---|---|---|
| Caenorhabditis elegans | 10 | 2 | 4 |
Statistics Data Visualization
L-tyrosine
