Compound Summary
Compound Information
physostigmine
Compound Name: | physostigmine |
Compound CID: | 5983 |
Synonyms: | physostigmine Eserine 57-47-6 Antilirium Physostol More... |
Iupac Name: | [(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-methylcarbamate |
InChI: | InChI=1S/C15H21N3O2/c1-15-7-8-17(3)13(15)18(4)12-6-5-10(9-11(12)15)20-14(19)16-2/h5-6,9,13H,7-8H2,1-4H3,(H,16,19)/t13-,15+/m1/s1 |
InChIKey: | PIJVFDBKTWXHHD-HIFRSBDPSA-N |
Canonical Smiles: | CC12CCN(C1N(C3=C2C=C(C=C3)OC(=O)NC)C)C |
Isomeric Smiles: | C[C@@]12CCN([C@@H]1N(C3=C2C=C(C=C3)OC(=O)NC)C)C |
Molecular Weight: | 275.35 |
Molecular Formula: | C15H21N3O2 |
Compound Structure
2D Structure:
3D Structure:
Computed Properties
physostigmine
Molecular Weight: | 275.35 |
Molecular Formula: | C15H21N3O2 |
Hydrogen Bond Donor Count: | 1 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 2 |
Heavy Atom Count: | 20 |
Complexity: | 403 |
Synonyms
physostigmine
| physostigmine | physostigmine |
|---|---|
physostigmine |
Eserine |
57-47-6 |
Antilirium |
Physostol |
Esromiotin |
Ezerin |
Calabarine |
Erserine |
Fysostigmin |
(-)-physostigmine |
(3aS,8aR)-1,3a,8-trimethyl-1,2,3,3a,8,8a-hexahydropyrrolo2,3-bindol-5-yl methylcarbamate |
Eserolein, methylcarbamate (ester) |
UNII-9U1VM840SP |
Eserine sulfate |
CHEMBL94 |
9U1VM840SP |
CHEBI:27953 |
NSC30782 |
NSC-30782 |
NCGC00093889-03 |
DSSTox_CID_3471 |
DSSTox_RID_77040 |
DSSTox_GSID_23471 |
Fysostigmin Czech |
(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo2,3-bindol-7-yl N-methylcarbamate |
CHEMBL537674 |
Pyrrolo(2,3-b)indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, methylcarbamate (ester), (3aS-cis)- |
CAS-57-47-6 |
CCRIS 3422 |
HSDB 3161 |
MCV 4484 |
EINECS 200-332-8 |
Eserolein, methylcarbamate |
NIH 10421 |
NSC 30782 |
Physostigmine USP:BAN |
RCRA waste no. P204 |
physostigmin |
CS 58525 |
Methyl-carbamic acid, ester with eseroline |
Carbamic acid, methyl-, ester with eseroline |
(-) physostigmine |
Eserine (TN) |
Physostigmine (USP) |
Physostigmine free base |
Spectrum_000916 |
Spectrum_001789 |
SpecPlus_000381 |
Prestwick0_000566 |
Prestwick1_000566 |
Prestwick2_000566 |
Prestwick3_000566 |
Spectrum2_000330 |
Spectrum2_000757 |
Spectrum2_001283 |
Spectrum3_000545 |
Spectrum3_000901 |
Spectrum4_000997 |
Spectrum4_001631 |
Spectrum4_001913 |
Spectrum5_000441 |
Spectrum5_000626 |
Spectrum5_001672 |
physostigmine.salicylic acid |
1,2,3,3abeta,8abeta-Hexahydro-1,3a,8-trimethylpyrrolo(2,3-b)-indol-5-yl methylcarbamate |
Lopac0_000483 |
SCHEMBL24044 |
BSPBio_000352 |
BSPBio_002189 |
KBioGR_001433 |
KBioGR_002061 |
KBioGR_002533 |
KBioSS_001396 |
KBioSS_002279 |
(3aS-cis)-1,2,3,3a,8,8a-Hexahydro-1,3a,8-trimethylpyrrolo(2,3-b)indol-5-ol methylcarbamate (ester) |
MLS001304022 |
DivK1c_006477 |
SPECTRUM1500753 |
SPBio_000339 |
SPBio_000774 |
SPBio_001285 |
SPBio_002571 |
BPBio1_000388 |
cid_657348 |
GTPL6598 |
MEGxp0_001872 |
DTXSID3023471 |
ACon1_000097 |
BDBM11023 |
KBio1_001421 |
KBio2_001396 |
KBio2_002278 |
KBio2_003964 |
KBio2_004846 |
KBio2_006532 |
KBio2_007414 |
KBio3_001689 |
KBio3_001842 |
Eserine, >=98.0% (N) |
HMS1921G06 |
HMS2089M11 |
HMS2236L08 |
HMS3261B07 |
BCP19735 |
Carbamic acid, ester with eseroline |
HY-N6608 |
MCV-4484 |
Pyrrolo(2,3-b)indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, 5-(N-methylcarbamate), (3aS,8aR)- |
Tox21_111228 |
Tox21_301591 |
Tox21_500483 |
BDBM50004000 |
BDBM50222010 |
CCG-38605 |
MFCD00151090 |
ZINC91689892 |
AKOS016843649 |
Tox21_111228_1 |
DB00981 |
LP00483 |
MCULE-2638001883 |
MCULE-9310809074 |
SDCCGMLS-0066585.P001 |
SDCCGSBI-0050467.P005 |
NCGC00093889-01 |
NCGC00093889-02 |
NCGC00093889-04 |
NCGC00093889-05 |
NCGC00093889-06 |
NCGC00093889-07 |
NCGC00093889-08 |
NCGC00093889-09 |
NCGC00093889-10 |
NCGC00093889-12 |
NCGC00093889-13 |
NCGC00093889-20 |
NCGC00255345-01 |
NCGC00261168-01 |
AC-15983 |
Pyrrolo(2,3-b)indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, methylcarbamate (ester), (3aS,8aR)- |
Pyrrolo(2,3-b)indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, methylcarbamate (ester), (3aS-cis) |
SMR000718753 |
SBI-0050467.P004 |
CS-0034353 |
EU-0100483 |
P0406 |
Physostigmine 100 microg/mL in Acetonitrile |
C06535 |
D00196 |
E 8375 |
Q410595 |
Eserine; Antilirium; Physostol; Esromiotin; Ezerin |
SR-01000075341-1 |
WLN: T B556 EN GNTT&J B1 E1 G1 KOVM1 |
BRD-K25650355-001-02-5 |
BRD-K25650355-059-02-3 |
BRD-K25650355-059-12-2 |
(3aS,8aR)-1,3a,8-trimethyl-1,2,3,3a,8,8a-hexahydropyrrolo2,3-bindol-5-yl methylcarbamate hydrochloride |
(3aS,8aR)-1,3a,8-trimethyl-1H,2H,3H,3aH,8H,8aH-pyrrolo2,3-bindol-5-yl N-methylcarbamate |
(3aS,8aR)-1,3a,8-trimethyl-1H,2H,3H,3aH,8H,8aH-pyrrolo2,3-bindol-5-yl N-methylcarbamate; 2-hydroxybenzoic acid |
Pyrrolo2, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, methylcarbamate (ester), (3aS-cis)- |
Experimental Data
physostigmine
| Species | Dosage | Unit | CG Lifespan(AVG/MED days) | TG Lifespan(AVG/MED days) | Lifespan Change(AVG/MED%) | CG Lifespan(MAX days) | TG Lifespan(MAX days) | Lifespan Change(MAX%) | Significant | Strain | Gender | PubMed | Active Label |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Caenorhabditis elegans | 33 | umol/L | 11 | NS | N2 | 24134630 | Inactive | ||||||
| Caenorhabditis elegans | 100 | umol/L | 15.99 | 16.67 | 4.205 | NS | N2 | 33008901 | Inactive | ||||
| Drosophila melanogaster | 200 | umol/L | 42.22 | 41.63 | -1.39 | NS | MALES | 33008901 | Inactive | ||||
| Caenorhabditis elegans | 10 | umol/L | 16.18 | 15.76 | -2.57 | NS | N2 | 33008901 | Inactive | ||||
| Drosophila melanogaster | 20 | umol/L | 47.99 | 48.45 | 0.97 | NS | FEMALES | 33008901 | Inactive |
Experimental Data Visualization
physostigmine
Statistics Data
physostigmine
| Species | Lifespan Change(AVG/MED%) | Lifespan Change(MAX%) | Count Reference | Count Data point |
|---|---|---|---|---|
| Caenorhabditis elegans | 11 | 2 | 3 | |
| Drosophila melanogaster | 0.97 | 1 | 2 |
Statistics Data Visualization
physostigmine
