Compound Summary
Compound Information
estradiol
Compound Name: | estradiol |
Compound CID: | 5757 |
Synonyms: | estradiol beta-Estradiol 17beta-Estradiol 50-28-2 Oestradiol More... |
Iupac Name: | (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
InChI: | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1 |
InChIKey: | VOXZDWNPVJITMN-ZBRFXRBCSA-N |
Canonical Smiles: | CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O |
Isomeric Smiles: | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4)O |
Molecular Weight: | 272.4 |
Molecular Formula: | C18H24O2 |
Compound Structure
2D Structure:
3D Structure:
Computed Properties
estradiol
Molecular Weight: | 272.4 |
Molecular Formula: | C18H24O2 |
Hydrogen Bond Donor Count: | 2 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 0 |
Heavy Atom Count: | 20 |
Complexity: | 382 |
Synonyms
estradiol
| estradiol | estradiol |
|---|---|
estradiol |
beta-Estradiol |
17beta-Estradiol |
50-28-2 |
Oestradiol |
Dihydrofolliculin |
Estrace |
Ovocyclin |
Vivelle |
progynon |
Dihydrotheelin |
Dihydroxyestrin |
Aquadiol |
Diogynets |
Gynergon |
Gynoestryl |
Diogyn |
Oestroglandol |
Aerodiol |
Corpagen |
Dimenformon |
Estrovite |
Femestral |
Follicyclin |
Ginosedol |
Macrodiol |
Oestergon |
Ovahormon |
Ovasterol |
Ovastevol |
Perlatanol |
Primofol |
Profoliol |
Altrad |
Bardiol |
Climara |
Divigel |
Evorel |
Femogen |
Lamdiol |
Syndiol |
Vagifem |
Dihydromenformon |
estradiol-17beta |
cis-Estradiol |
Estraderm TTS |
Estraderm |
Estraldine |
Estroclim |
Trocosone |
Estrogel |
Menorest |
Nordicol |
Zumenon |
Systen |
D-Oestradiol |
D-Estradiol |
Progynon DH |
Climaderm |
Compudose |
Dermestril |
Estrasorb |
Ovocycline |
Encore |
Estring |
Menest |
Oesclim |
Dihydroxyoestrin |
SK-Estrogens |
Progynon-DH |
Gynestrel |
Microdiol |
Oestrogynal |
Ovociclina |
Ovocylin |
Tradelia |
Estroclim 50 |
Innofem |
Macrol |
Zerella |
17beta-Oestradiol |
Alora |
Oestradiol R |
Estring vaginal ring |
Dihydrofollicular hormone |
Trial SAT |
Theelin, dihydro- |
Elestrin |
Fempatch |
Gynodiol |
Oestrogel |
Esclim |
Compudose 200 |
Compudose 365 |
Profoliol B |
17b-Oestradiol |
17-beta-estradiol |
Estradiol-17-beta |
Estradot |
Gelestra |
3,17-Epidihydroxyestratriene |
Zesteem |
Dihydroxyesterin |
cis-Oestradiol |
Estraderm TTS 50 |
Estrogens, esterified |
B-Estradiol |
Epiestriol 50 |
17beta oestradiol |
NSC-9895 |
17 beta-Estradiol |
Estradiol-17 beta |
Evamist |
Amnestrogen |
Estrogen |
Femanest |
Estra-1,3,5(10)-triene-3,17beta-diol |
3,17-Epidihydroxyoestratriene |
Sandrena 1 |
17b-Estradiol |
(17beta)-Estra-1,3,5(10)-triene-3,17-diol |
Estraderm (TN) |
3H-estradiol |
17|A-estradiol |
17|A-Oestradiol |
Estrogel (TN) |
Climara (TN) |
Divigel (TN) |
Estrace (TN) |
Estring (TN) |
Innofem (TN) |
Vagifem (TN) |
Vivelle (TN) |
17.beta.-Estradiol |
17.beta.-Oestradiol |
3,17.beta.-Estradiol |
.beta.-Estradiol |
(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopentaaphenanthrene-3,17-diol |
.beta.-Oestradiol |
3Hestradiol |
UNII-4TI98Z838E |
Estradiol, .beta.- |
Estradiol-17.beta. |
CHEBI:16469 |
Estra-1,3,5(10)-triene-3,17-diol (17beta)- |
Oestradiol-17.beta. |
ESTRADIOL HEMIHYDRATE |
Oestra-1,3,5(10)-triene-3,17beta-diol |
Estrasorb (TN) |
17.beta.-OH-estradiol |
17.beta.-OH-oestradiol |
17beta estradiol (E2) |
Extrasorb |
17beta-Estra-1,3,5(10)-triene-3,17-diol |
Estreva |
Estrifam |
Femtran |
Ginedisc |
CHEMBL135 |
GynPolar |
(17beta)-estra-1(10),2,4-triene-3,17-diol |
Sandrena Gel |
D-3,17.beta.-Estradiol |
D-3,17.beta.-Oestradiol |
Sisare Gel |
Estra-1,3,5(10)-triene-3,17-diol, (17beta)- |
Estrofem 2 |
MLS000069494 |
3,17b-Dihydroxyestra-1,3,5(10)-triene |
Oestradiolum |
Climara Forte |
4TI98Z838E |
Oestradiol Berco |
Estraderm MX |
VIVELLE-DOT |
1,3,5-Estratriene-3,17beta-diol |
3HE2 |
Oestradiol-17beta |
Estrapak 50 |
(1S,10R,11S,14S,15S)-15-methyltetracyclo8.7.0.0^{2,7}.0^{11,15}heptadeca-2(7),3,5-triene-5,14-diol |
141290-02-0 |
Estradiolum INN |
Estradiolo DCIT |
NCGC00091544-04 |
Oestradiol-17-beta |
Estradiolum |
Estrodiolum |
Estradiolo |
Femestrol |
SMR000059126 |
Estradiol-3,17beta |
DSSTox_CID_573 |
17-beta-OH-estradiol |
3,17-beta-Estradiol |
3,17beta-Dihydroxy-1,3,5(10)-estratriene |
3,17beta-Dihydroxyestra-1,3,5(10)-triene |
3,17-beta-Oestradiol |
D-3,17beta-Estradiol |
E(sub 2) |
DSSTox_RID_75666 |
Methyl 1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxo-1,4-dihydroquinoline-3-carboxylate. |
Benzogynestry |
DSSTox_GSID_20573 |
Estropause |
Estasorb |
(8R,9S,13S,14S,17S)-13-Methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopentaaphenanthrene-3,17-diol |
2,4,6,7-3H-E2 |
E 2 |
E2 |
Destradiol |
Minivelle |
Yuvvexy |
Zesteen |
17-beta-OH-oestradiol |
D-3,17beta-Oestradiol |
D-3,17-beta-Estradiol |
Estrodiolum INN-Latin |
NSC-20293 |
D-3,17-beta-Oestradiol |
Activella (Salt/Mix) |
Combipatch (Salt/Mix) |
CCRIS 280 |
component of Menrium |
Estradiol-17 alpha |
Climara Pro (Salt/Mix) |
3,17beta-Estradiol |
3,17-.beta.-Oestradiol |
Estraderm TTS 100 |
HSDB 3589 |
3,3,5(10)-triene |
SR-01000075866 |
17-.BETA.-Estradiol |
EINECS 200-023-8 |
Estra-1,3,5(10)-triene-3,17-diol (17.beta.)- |
(+)-3,17.beta.-Estradiol |
1,3,5-Estratriene-3,17-beta-diol |
oestrodiol |
Estradiol USP:INN:BAN |
3,17beta-Dihydroxyestra-1,3,5-triene |
3,17beta-Dihydroxyoestra-1,3,5-triene |
Elestrim |
delta-Estradiol |
dihydro-Theelin |
3,17-beta-Dihydroxyoestra-1,3,5-triene |
delta-Oestradiol |
TX-004HR |
MFCD00003693 |
Estra-1,3,5(10)-triene-3,17-beta-diol |
Estradiol complex |
Estrogel HBF |
Oestra-1,3,5(10)-triene-3,17-beta-diol |
1jgl |
1lhu |
1qkt |
1qku |
3,17-beta-Dihydroxyestra-1,3,5(10)-triene |
3Hestradiol |
1,3,5-Estratriene-3,17.beta.-diol |
3,17-beta-Dihydroxy-1,3,5(10)-oestratriene |
CAS-50-28-2 |
17-beta-Estra-1,3,5(10)-triene-3,17-diol |
17beta-Oestra-1,3,5(10)-triene-3,17-diol |
.alpha.-Oestradiol |
17-beta-Oestra-1,3,5(10)-triene-3,17-diol |
Estra-1,3,5(10)-triene-3,17-diol |
Prestwick_207 |
3,17b-Estradiol |
Bio-E-Gel |
Fem7 |
3H-Estrogen |
17 ?-Estradiol |
3,17.beta.-Dihydroxyestra-1,3,5-triene |
3,17.beta.-Dihydroxyoestra-1,3,5-triene |
CMC_11154 |
1,3,5,(10)-Estratrien-3,17.beta.-diol |
SL-1100 |
Estra-1,3,5(10)-triene-3,17.beta.-diol |
Oestra-1,3,5(10)-triene-3,17.beta.-diol |
2j7x |
3,17.beta.-Dihydroxy-1,3,5(10)-estratriene |
3,17.beta.-Dihydroxy-1,3,5(10)-oestratriene |
3,17.beta.-Dihydroxyestra-1,3,5(10)-triene |
3,3,5-triene |
3H17beta-estradiol |
(17?)-Estra-1,3,5(10)-triene-3,17-diol |
17.beta.-Estra-1,3,5(10)-triene-3,17-diol |
17.beta.-Oestra-1,3,5(10)-triene-3,17-diol |
Opera_ID_1688 |
Prestwick0_000441 |
Prestwick1_000441 |
Prestwick2_000441 |
Prestwick3_000441 |
Spectrum5_002055 |
17beta-estradiol (E2) |
alpha-estradiol (obsolete) |
beta-Estradiol, >=98% |
bmse000642 |
Epitope ID:136018 |
(+)-3,17b-Estradiol |
E 8875 |
EC 200-023-8 |
SCHEMBL8049 |
(+)-3,17beta-Estradiol |
Estradiol (JAN/USP/INN) |
Tritiated estradiol-17-beta |
BIDD:PXR0065 |
Lopac0_000503 |
S-21400 |
BSPBio_000482 |
BSPBio_001065 |
KBioGR_000405 |
KBioGR_002269 |
KBioSS_000405 |
KBioSS_002270 |
Oestradiol-17beta and esters |
MLS000758312 |
MLS001076331 |
MLS001424022 |
BIDD:ER0125 |
Oestradiol-17beta and esters Steroidal oestrogens |
SPBio_002421 |
BPBio1_000532 |
GTPL1012 |
GTPL1013 |
DTXSID0020573 |
NIOSH/KG7030000 |
BDBM17292 |
KBio2_000405 |
KBio2_002269 |
KBio2_002973 |
KBio2_004837 |
KBio2_005541 |
KBio2_007405 |
KBio3_000769 |
KBio3_000770 |
KBio3_002749 |
AOB5963 |
NSC9895 |
1a52 |
1g50 |
2d06 |
cMAP_000005 |
Bio1_000403 |
Bio1_000892 |
Bio1_001381 |
Bio2_000363 |
Bio2_000843 |
HMS1362E07 |
HMS1569I04 |
HMS1792E07 |
HMS1990E07 |
HMS2051C17 |
HMS2090E18 |
HMS2096I04 |
HMS2236H04 |
HMS3261F07 |
HMS3403E07 |
HMS3713I04 |
HMS3884A08 |
beta-Estradiol, analytical standard |
ACN-S003579 |
BCP08579 |
HY-B0141 |
Tox21_111148 |
Tox21_202057 |
Tox21_300288 |
Tox21_500503 |
1,5-Estratriene-3,17.beta.-diol |
LMST02010001 |
s1709 |
WC3011 |
ZINC13520815 |
Estradiol-17-beta-6,7-(sup 3)H |
2,4,6,7-3H-17beta-estradiol |
AKOS015896570 |
CCG-100808 |
CS-1938 |
DB00783 |
LP00503 |
NC00058 |
SDCCGSBI-0050487.P002 |
WC-3011 |
IDI1_002118 |
SMP1_000121 |
NCGC00091544-00 |
NCGC00091544-01 |
NCGC00091544-02 |
NCGC00091544-05 |
NCGC00091544-06 |
NCGC00091544-07 |
NCGC00091544-09 |
NCGC00091544-10 |
NCGC00091544-11 |
NCGC00091544-12 |
NCGC00091544-13 |
NCGC00091544-14 |
NCGC00091544-15 |
NCGC00091544-16 |
NCGC00091544-18 |
NCGC00091544-27 |
NCGC00179321-01 |
NCGC00179321-02 |
NCGC00254177-01 |
NCGC00259606-01 |
NCGC00261188-01 |
17-E |
AC-22346 |
AS-13729 |
CPD000059126 |
Estra-1,3,5(10)-triene-3,17b-diol |
Oestra-1,3,5(10)-triene-3,17b-diol |
WLN: L E5 B666TTT&J E1 FQ OQ |
AB0012866 |
Estra-1,5(10)-triene-3,17.beta.-diol |
Estradiol, meets USP testing specifications |
3,17beta-dihydroxyestra-1,3,5(10)-trien |
EU-0100503 |
KG70300000 |
Oestra-1,5(10)-triene-3,17.beta.-diol |
C00951 |
D00105 |
J10189 |
(17b)-Estra-1,3,5(10)-triene-3,17-diol |
13b-Methyl-1,3,5(10)-gonatriene-3,17b-ol |
17-decahydrocyclopentaaphenanthrene-3,17-diol |
17.beta.-Estra-1,5(10)-triene-3,17-diol |
17.beta.-Oestra-1,5(10)-triene-3,17-diol |
003E693 |
17-beta-Estradiol 100 microg/mL in Acetonitrile |
Q422416 |
SR-01000721892 |
13beta-Methyl-1,3,5(10)-gonatriene-3,17beta-ol |
Estra-1,5(10)-triene-3,17-diol (17.beta.)- |
Q-201503 |
SR-01000075866-1 |
SR-01000075866-4 |
SR-01000721892-3 |
BRD-K18910433-001-04-4 |
BRD-K18910433-001-43-2 |
estra-1(10),2,4-triene-3,17-diol, (17beta)- |
Estra-1,5(10)-triene-3,17-diol, (17.beta.)- |
Z1847670481 |
B8B5AEF5-4957-49EB-A14F-444A8212C482 |
beta-Estradiol, BioReagent, powder, suitable for cell culture |
Estradiol, United States Pharmacopeia (USP) Reference Standard |
beta-Estradiol, powder, gamma-irradiated, suitable for cell culture |
Estra-1,3,5(10)-triene-3,17-diol, (6,7-(sup 3)H,17-beta)- |
(9beta,13alpha,14beta,17alpha)-estra-1,3,5(10)-triene-3,17-diol |
Estradiol, Pharmaceutical Secondary Standard; Certified Reference Material |
(13S,17S)-13-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopentaaphenanthrene-3,17-beta-diol |
(1S,10R,11S,14S,15S)-15-methyltetracyclo8.7.0.0;{2,7}.0;{11,15}heptadeca-2,4,6-triene-5,14-diol |
(8S,9S,13S,14S,17S)-13-Methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopentaaphenanthrene-3,17-diol |
17beta-Estradiol solution, 1.0 mg/mL in acetonitrile, ampule of 1 mL, certified reference material |
Experimental Data
estradiol
| Species | Dosage | Unit | CG Lifespan(AVG/MED days) | TG Lifespan(AVG/MED days) | Lifespan Change(AVG/MED%) | CG Lifespan(MAX days) | TG Lifespan(MAX days) | Lifespan Change(MAX%) | Significant | Strain | Gender | PubMed | Active Label |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Caenorhabditis elegans | 50 | umol/L | 9.77 | NS | N2 | 30970250 | Inactive | ||||||
| Caenorhabditis elegans | 33 | umol/L | 7 | S | N2 | 24134630 | Active | ||||||
| Caenorhabditis elegans | 33 | umol/L | 7 | S | N2 | 33683565 | Active |
Experimental Data Visualization
estradiol
Statistics Data
estradiol
| Species | Lifespan Change(AVG/MED%) | Lifespan Change(MAX%) | Count Reference | Count Data point |
|---|---|---|---|---|
| Caenorhabditis elegans | 9.77 | 3 | 3 |
Statistics Data Visualization
estradiol
