Compound Summary
Compound Information
Chlorpheniramine maleate
Compound Name: | Chlorpheniramine maleate |
Compound CID: | 5281068 |
Synonyms: | Chlorpheniramine maleate 113-92-8 Chlorphenamine Maleate Piriton Antagonate More... |
Iupac Name: | (Z)-but-2-enedioic acid;3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine |
InChI: | InChI=1S/C16H19ClN2.C4H4O4/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13;5-3(6)1-2-4(7)8/h3-9,11,15H,10,12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
InChIKey: | DBAKFASWICGISY-BTJKTKAUSA-N |
Canonical Smiles: | CN(C)CCC(C1=CC=C(C=C1)Cl)C2=CC=CC=N2.C(=CC(=O)O)C(=O)O |
Isomeric Smiles: | CN(C)CCC(C1=CC=C(C=C1)Cl)C2=CC=CC=N2.C(=C\C(=O)O)\C(=O)O |
Molecular Weight: | 390.9 |
Molecular Formula: | C20H23ClN2O4 |
Compound Structure
2D Structure:
3D Structure:
Computed Properties
Chlorpheniramine maleate
Molecular Weight: | 390.9 |
Molecular Formula: | C20H23ClN2O4 |
Hydrogen Bond Donor Count: | 2 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 7 |
Heavy Atom Count: | 27 |
Complexity: | 368 |
Synonyms
Chlorpheniramine maleate
| Chlorpheniramine maleate | Chlorpheniramine maleate |
|---|---|
Chlorpheniramine maleate |
113-92-8 |
Chlorphenamine Maleate |
Piriton |
Antagonate |
Kloromin |
Chlorphenamine hydrogen maleate |
Chlorpheniramine (maleate) |
NCI-C55265 |
Polaronil |
C16H19ClN2.C4H4O4 |
Chlorphenamine maleates |
MFCD00069225 |
Chloropheniramine maleate |
CHEBI:3645 |
(+/-)-Chlorpheniramine maleate salt |
Neorestamin |
Allerclor |
Allergin |
Chlormene |
Ibioton |
Lorphen |
Synistamin |
Alunex |
Dehist |
Piriex |
Chlor-tripolon |
3-(4-chlorophenyl)-N,N-dimethyl-3-(pyridin-2-yl)propan-1-amine maleate |
C-Meton |
(Z)-but-2-enedioic acid;3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine |
Histadur dura-tabs |
Chlor-Trimeton OD |
Pyridamal 100 |
Pyridamal-100 |
Polaronil German |
Carbinoxamide maleate |
Chlor-Trimeton Allergy |
Phenalin |
Chlor-Trimeton Injection |
Chlorprophenpyridamine maleate |
Histaspan-Plus |
Histaspan-D |
Medique chlorphen |
dl-Chlorpheniramine maleate |
Ru-Tuss Capsules |
SMR000466271 |
Chloroprophenpyridamine maleate |
CCRIS 1418 |
3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-aminium (2Z)-3-carboxyprop-2-enoate |
Chlor-trimeton 12 hour |
Efidac 24 Chlorpheniramine Maleate |
SR-01000075261 |
M.P. chlorcaps T.D. |
EINECS 204-037-5 |
Chlorpheniramine maleate OROS Tablets |
Nasohist |
Corfen |
Lohist |
Chlor-Trimeton Repetabs, Syrup, and Tablets |
Sine off |
Sildec PE |
Alka-seltzer plus |
Prestwick_57 |
Chlorpheniramine maleate USP:JAN |
Teldrin (TN) |
Chlorophenaminemaleate |
Zodryl AC 25 |
Zodryl AC 30 |
Zodryl AC 40 |
Zodryl AC 50 |
Zodryl AC 60 |
Zodryl AC 80 |
Chlor-trimeton (TN) |
3-(4-chlorophenyl)-3-(2-pyridyl)propyldimethylamine, (2Z)but-2-enedioic acid |
1-p-Chlorophenyl-1-(2-pyridyl)-3-dimethylaminopropane maleate |
dl-2-(p-Chloro-alpha-2-(dimethylamino)ethylbenzyl)pyridine maleate |
1-(N,N-Dimethylamino)-3-(p-chlorophenyl-3-alpha-pyridyl)propane maleate |
1-(p-Chlorphenyl)-1-(2-pyridyl)-3-dimethylaminopropan maleat German |
2-(p-Chloro-alpha-(2-(dimethylamino)ethyl)benzyl)pyridine maleate (1:1) |
CHEMBL1659 |
(y)-Chlorpheniramine maleate |
Chlorpheniramine Maleate Salt |
SCHEMBL33357 |
(?)-Chlorpheniramine maleate |
MLS000758311 |
MLS001148230 |
MLS001424173 |
(+/-)-Chlorpheniramine maleate |
HMS501N18 |
HY-B0286A |
(A+/-)-Chlorpheniramine maleate |
AMF0009 |
1-(p-Chlorphenyl)-1-(2-pyridyl)-3-dimethylaminopropan maleat |
HMS1568G16 |
HMS2051L14 |
HMS2093N19 |
HMS2095G16 |
HMS2230F21 |
HMS2232B23 |
HMS3260F04 |
HMS3712G16 |
HMS3884O10 |
Pharmakon1600-01505530 |
Tox21_500261 |
AC-267 |
NSC759156 |
s1816 |
Chlorpheniramine maleate (JP17/USP) |
AKOS015951220 |
Pyridine, 2-(p-chloro-alpha-(2-(dimethylamino)ethyl)benzyl)-, maleate (1:1) |
CCG-101036 |
CCG-220117 |
CCG-221565 |
LP00261 |
NC00286 |
NSC 756684 |
NSC-759156 |
2-Pyridinepropanamine, gamma-(4-chlorophenyl)-N,N-dimethyl-, (Z)-2-butenedioate (1:1) |
NCGC00093720-01 |
NCGC00093720-02 |
NCGC00260946-01 |
AS-13167 |
H497 |
SMR000653461 |
ST024753 |
EU-0100261 |
SW196372-4 |
C 3025 |
C07780 |
D00665 |
D70131 |
J10224 |
( inverted question mark)-Chlorpheniramine maleate |
SR-01000075261-1 |
SR-01000075261-9 |
W-108612 |
Q27106157 |
F2173-0923 |
(+/-)-Chlorpheniramine maleate salt >=99% (perchloric acid titration) |
(+/-)-Chlorpheniramine maleate salt, >=99% (perchloric acid titration) |
Chlorphenamine maleate, European Pharmacopoeia (EP) Reference Standard |
2-Pyridinepropanamine, gamma-(4-chlorophenyl)-N,N-dimethyl-, (2Z)-2-butenedioate (1:1) |
Chlorphenamine Maleate (Chlorpheniramine Maleate) 1.0 mg/ml in Methanol (as free base) |
Chlorpheniramine Maleate, Pharmaceutical Secondary Standard; Certified Reference Material |
Chlorpheniramine maleate, United States Pharmacopeia (USP) Reference Standard |
Chlorpheniramine maleate salt solution, 1.0 mg/mL in methanol (as free base), ampule of 1 mL, certified reference material |
Experimental Data
Chlorpheniramine maleate
| Species | Dosage | Unit | CG Lifespan(AVG/MED days) | TG Lifespan(AVG/MED days) | Lifespan Change(AVG/MED%) | CG Lifespan(MAX days) | TG Lifespan(MAX days) | Lifespan Change(MAX%) | Significant | Strain | Gender | PubMed | Active Label |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Caenorhabditis elegans | 33 | umol/L | 2 | NS | N2 | 24134630 | Inactive |
Experimental Data Visualization
Chlorpheniramine maleate
Statistics Data
Chlorpheniramine maleate
| Species | Lifespan Change(AVG/MED%) | Lifespan Change(MAX%) | Count Reference | Count Data point |
|---|---|---|---|---|
| Caenorhabditis elegans | 2 | 1 | 1 |
Statistics Data Visualization
Chlorpheniramine maleate
