Compound Summary
Compound Information
propyl gallate
Compound Name: | propyl gallate |
Compound CID: | 4947 |
Synonyms: | propyl gallate 121-79-9 Propyl 3,4,5-trihydroxybenzoate N-Propyl gallate Tenox PG More... |
Iupac Name: | propyl 3,4,5-trihydroxybenzoate |
InChI: | InChI=1S/C10H12O5/c1-2-3-15-10(14)6-4-7(11)9(13)8(12)5-6/h4-5,11-13H,2-3H2,1H3 |
InChIKey: | ZTHYODDOHIVTJV-UHFFFAOYSA-N |
Canonical Smiles: | CCCOC(=O)C1=CC(=C(C(=C1)O)O)O |
Isomeric Smiles: | CCCOC(=O)C1=CC(=C(C(=C1)O)O)O |
Molecular Weight: | 212.2 |
Molecular Formula: | C10H12O5 |
Compound Structure
2D Structure:
3D Structure:
Computed Properties
propyl gallate
Molecular Weight: | 212.2 |
Molecular Formula: | C10H12O5 |
Hydrogen Bond Donor Count: | 3 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 4 |
Heavy Atom Count: | 15 |
Complexity: | 206 |
Synonyms
propyl gallate
| propyl gallate | propyl gallate |
|---|---|
propyl gallate |
121-79-9 |
Propyl 3,4,5-trihydroxybenzoate |
N-Propyl gallate |
Tenox PG |
Progallin P |
Gallic acid, propyl ester |
Nipagallin P |
Gallic acid propyl ester |
NIPA 49 |
3,4,5-Trihydroxybenzoic acid propyl ester |
Benzoic acid, 3,4,5-trihydroxy-, propyl ester |
n-Propyl 3,4,5-trihydroxybenzoate |
3,4,5-Trihydroxybenzene-1-propylcarboxylate |
Propylester kyseliny gallove |
n-Propyl ester of 3,4,5-trihydroxybenzoic acid |
FEMA No. 2947 |
Gallic acid n-propyl ester |
NSC 2626 |
3,4,5-Trihydroxybenzoic acid, propyl ester |
NCI-C505888 |
3,4,5-Trihydroxybenzoic acid n-propyl ester |
UNII-8D4SNN7V92 |
Nipanox S 1 |
Propyl gallate (NF) |
Propyl gallate NF |
CHEMBL7983 |
Gallic acid, n-propyl ester |
E310 |
8D4SNN7V92 |
CHEBI:10607 |
NSC2626 |
NSC-2626 |
MFCD00002196 |
NCGC00164234-01 |
DSSTox_CID_1201 |
DSSTox_RID_76009 |
DSSTox_GSID_21201 |
Gallate, Propyl |
Pro gallin P |
CAS-121-79-9 |
CCRIS 541 |
HSDB 591 |
n-Propyl-3,4,5-Trihydroxybenzoate |
EINECS 204-498-2 |
Propylester kyseliny gallove Czech |
Propyl galiate |
AI3-17136 |
n-propyl-gallate |
Sustane PG |
n-Propyl gallate| |
Propylgallate,(S) |
Propyl Gallate FCC |
Propyl gallate, powder |
Propyl gallate, 98% |
ACMC-209ahq |
Gallic acid-propyl ester |
3,4,5-Trihydroxy-benzoic acid propyl ester |
Gallic acid propyl esterZ |
Oprea1_580415 |
SCHEMBL22630 |
CBDivE_013134 |
BIDD:ER0334 |
Propyl 3,5-trihydroxybenzoate |
WLN: QR BQ CQ EVO3 |
INS NO.310 |
DTXSID5021201 |
FEMA 2947 |
n-Propyl 3,5-trihydroxybenzoate |
Propyl gallate, >=98%, FCC |
INS-310 |
NCI-C50588 |
BCP13340 |
HY-N0524 |
ZINC1532172 |
Tox21_113531 |
Tox21_202286 |
Tox21_300060 |
BDBM50032154 |
CP0103 |
s5113 |
SBB060377 |
AKOS001603853 |
ANGC-121-79-9 |
5-Methyl-4,5-dihydrothiazole-2-thiol |
CCG-207932 |
DB12450 |
MCULE-2693876364 |
NCGC00164234-02 |
NCGC00164234-03 |
NCGC00164234-04 |
NCGC00254138-01 |
NCGC00259835-01 |
3,5-Trihydroxybenzene-1-propylcarboxylate |
3,5-Trihydroxybenzoic acid, propyl ester |
AC-11365 |
AC-34485 |
AS-11986 |
NCI60_002094 |
Propyl gallate, USP, 98.0-102.0% |
DB-003766 |
Benzoic acid,4,5-trihydroxy-, propyl ester |
CS-0009059 |
E-310 |
EU-0036319 |
FT-0626599 |
G0018 |
ST50307922 |
n-Propyl ester of 3,5-trihydroxybenzoic acid |
A19435 |
D02382 |
J10100 |
Propyl gallate, antioxidant, >=98.0% (HPLC) |
Q608726 |
SR-01000944710 |
Propyl gallate, for microscopy, >=98.0% (HPLC) |
Q-201634 |
SR-01000944710-1 |
EFFF5FFA-651C-4DE3-A25F-D807C65D5537 |
Propyl gallate, European Pharmacopoeia (EP) Reference Standard |
Propyl gallate, United States Pharmacopeia (USP) Reference Standard |
Propyl gallate, Pharmaceutical Secondary Standard; Certified Reference Material |
Experimental Data
propyl gallate
| Species | Dosage | Unit | CG Lifespan(AVG/MED days) | TG Lifespan(AVG/MED days) | Lifespan Change(AVG/MED%) | CG Lifespan(MAX days) | TG Lifespan(MAX days) | Lifespan Change(MAX%) | Significant | Strain | Gender | PubMed | Active Label |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Caenorhabditis elegans | 53 | umol/L | Unclear | N2 | 33683565 | ||||||||
| Caenorhabditis elegans | 50 | umol/L | 1.29 | Unclear | N2 | 33683565 | |||||||
| Caenorhabditis elegans | 100 | umol/L | 5.05 | Unclear | N2 | 33683565 | |||||||
| Caenorhabditis elegans | 500 | umol/L | Unclear | N2 | 33683565 | ||||||||
| Caenorhabditis elegans | 1.3 | mM | Unclear | N2 | 33683565 | ||||||||
| Caenorhabditis elegans | 1 | mM | Unclear | N2 | 33683565 | ||||||||
| Bactrocera musae | 25 | ug/mL | 34.78 | 15.1 | 76.33 | Unclear | MALES | 8950031 | |||||
| Bactrocera musae | 25 | ug/mL | 41.62 | 8.7 | 83 | Unclear | FEMALES | 8950031 | |||||
| Caenorhabditis elegans | 1 | mM | 15 | 17 | 0.13 | S | N2 | 18755260 | Active | ||||
| Caenorhabditis elegans | 1 | mM | 15 | 17 | 0.13 | S | N2 | 18755260 | Active | ||||
| Caenorhabditis elegans | 200 | umol/L | 18 | 19 | 0.06 | S | N2 | 31820364 | Active | ||||
| Caenorhabditis elegans | 100 | umol/L | 15 | 16 | 0.07 | NS | N2 | 18755260 | Inactive | ||||
| Caenorhabditis elegans | 50 | umol/L | 15 | 17 | 0.13 | S | N2 | 18755260 | Active | ||||
| Caenorhabditis elegans | 1 | mM | 15 | 16 | 0.07 | NS | N2 | 18755260 | Inactive |
Experimental Data Visualization
propyl gallate
Statistics Data
propyl gallate
| Species | Lifespan Change(AVG/MED%) | Lifespan Change(MAX%) | Count Reference | Count Data point |
|---|---|---|---|---|
| Bactrocera musae | 15.1 | 1 | 2 | |
| Caenorhabditis elegans | 0.13 | 5.05 | 3 | 12 |
Statistics Data Visualization
propyl gallate
