Compound Summary
Compound Information
riboflavin
Compound Name: | riboflavin |
Compound CID: | 493570 |
Synonyms: | riboflavin vitamin B2 Riboflavine Lactoflavin 83-88-5 More... |
Iupac Name: | 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione |
InChI: | InChI=1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m0/s1 |
InChIKey: | AUNGANRZJHBGPY-SCRDCRAPSA-N |
Canonical Smiles: | CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(CO)O)O)O |
Isomeric Smiles: | CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)C[C@@H]([C@@H]([C@@H](CO)O)O)O |
Molecular Weight: | 376.4 |
Molecular Formula: | C17H20N4O6 |
Compound Structure
2D Structure:
3D Structure:
Computed Properties
riboflavin
Molecular Weight: | 376.4 |
Molecular Formula: | C17H20N4O6 |
Hydrogen Bond Donor Count: | 5 |
Hydrogen Bond Acceptor Count: | 7 |
Rotatable Bond Count: | 5 |
Heavy Atom Count: | 27 |
Complexity: | 680 |
Synonyms
riboflavin
| riboflavin | riboflavin |
|---|---|
riboflavin |
vitamin B2 |
Riboflavine |
Lactoflavin |
83-88-5 |
Vitamin G |
Lactoflavine |
Flavaxin |
(-)-riboflavin |
Beflavin |
Riboflavina |
Riboflavinum |
Beflavine |
Russupteridine Yellow III |
7,8-Dimethyl-10-ribitylisoalloxazine |
6,7-Dimethyl-9-D-ribitylisoalloxazine |
Ribocrisina |
Vitaflavine |
Flaxain |
Lactobene |
Ribipca |
Riboderm |
Ribosyn |
Ribotone |
Ribovel |
E101 |
Vitamin Bi |
Flavin BB |
Vitasan B2 |
HYRE |
Riboflavin (Vitamin B2) |
UNII-TLM2976OFR |
Riboflavinequinone |
CHEBI:17015 |
7,8-Dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)isoalloxazine |
MFCD00005022 |
TLM2976OFR |
7,8-dimethyl-10-(2S,3S,4R)-2,3,4,5-tetrahydroxypentylbenzogpteridine-2,4-dione |
1-deoxy-1-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzogpteridin-10(2H)-yl)-D-ribitol |
1-Deoxy-1-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzogpteridin-10(2H)-yl)pentitol |
D-Ribitol, 1-deoxy-1-(3,4-dihydro-7,8-dimethyl-2,4-dioxobenzo(g)pteridin-10(2H)-yl)- |
NSC 33298 |
DSSTox_CID_1777 |
DSSTox_RID_76321 |
DSSTox_GSID_21777 |
Riboflavine INN-French |
Riboflavinum INN-Latin |
Riboflavina INN-Spanish |
Isoalloxazine, 7,8-dimethyl-10-D-ribityl- |
HSDB 817 |
7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)benzogpteridine-2,4(3H,10H)-dione |
CCRIS 1904 |
Isoalloxazine, 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)- |
Riboflavin (Vit B2) |
EINECS 201-507-1 |
Riboflavin USP:INN:BAN |
AI3-14697 |
NSC-33298 |
1kyv |
2ccb |
2vxa |
()-Riboflavin |
San Yellow B |
CAS-83-88-5 |
NCGC00017291-05 |
Bisulase (TN) |
Food Yellow 15 |
Prestwick_442 |
2fl5 |
2vx9 |
4d1y |
Prestwick3_000634 |
Epitope ID:161730 |
SCHEMBL7706 |
CHEMBL1534 |
BSPBio_000628 |
MLS001066391 |
BPBio1_000692 |
GTPL6578 |
Riboflavin (JP17/USP/INN) |
RIBOFLAVINE; VITAMIN B2 |
DTXSID8021777 |
INS NO. 101(I) |
(-)-Riboflavin, 97-103% |
HMS2096P10 |
Benzogpteridine riboflavin deriv. |
HY-B0456 |
ZINC2036848 |
Tox21_110813 |
Tox21_111714 |
Tox21_201633 |
Tox21_302980 |
6,7-Dimethyl-9-ribitylisoalloxazine |
BDBM50362895 |
s2540 |
Riboflavin (B2), analytical standard |
Tox21_111714_1 |
DB00140 |
NCI-0033298 |
NCGC00091288-01 |
NCGC00091288-02 |
NCGC00091288-03 |
NCGC00091288-05 |
NCGC00179498-01 |
NCGC00256408-01 |
NCGC00259182-01 |
7,8-dimethyl-10-((2S,3S,4R)-2,3,4,5-tetrahydroxypentyl)benzogpteridine-2,4(3H,10H)-dione |
AS-15936 |
R437 |
SMR000112236 |
AB0008077 |
R0020 |
(-)-Riboflavin, tested according to Ph.Eur. |
C00255 |
D00050 |
(-)-Riboflavin, meets USP testing specifications |
A840676 |
A934900 |
Q130365 |
(-)-Riboflavin, from Eremothecium ashbyii, >=98% |
W-104132 |
(-)-Riboflavin, acrylamide photopolymerization tested |
Riboflavin, European Pharmacopoeia (EP) Reference Standard |
Riboflavin, United States Pharmacopeia (USP) Reference Standard |
3,10-Dihydro-7,8-dimethyl-10-(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl |
Riboflavin, Pharmaceutical Secondary Standard; Certified Reference Material |
5-deoxy-5-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzogpteridin-10(2H)-yl)-D-ribitol |
7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-Benzogpteridine-2,4(3H,10H)-dione |
Riboflavin for peak identification, European Pharmacopoeia (EP) Reference Standard |
(-)-Riboflavin (Vitamin B2) solution, 100 mug/mL (Methanol:0.1% Ammonium acetate in Water (1:1)), ampule of 1 mL, analytical standard |
(-)-Riboflavin, 100 mug/mL (1% ammonium acetate in 50:50 methanol:water), certified reference material, ampule of 1 mL |
(-)-Riboflavin, BioReagent, suitable for cell culture, suitable for insect cell culture, >=98% |
(-)-Riboflavin-13C4,15N2 (Vitamin B2-13C4,15N2) solution, 100 mug/mL (1% ammonium acetate in 50:50 methanol:water), certified reference material, ampule of 1 mL |
7,8-dimethyl-10-(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl-2H,3H,4H,10H-benzogpteridine-2,4-dione |
7,8-dimethyl-10-(2S,3S,4R)-2,3,4,5-tetrakis(oxidanyl)pentylbenzogpteridine-2,4-dione |
Experimental Data
riboflavin
| Species | Dosage | Unit | CG Lifespan(AVG/MED days) | TG Lifespan(AVG/MED days) | Lifespan Change(AVG/MED%) | CG Lifespan(MAX days) | TG Lifespan(MAX days) | Lifespan Change(MAX%) | Significant | Strain | Gender | PubMed | Active Label |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Drosophila melanogaster | 0.025 | mg/mL | 55.98 | 53.34 | -0.05 | NS | 31137639 | Inactive | |||||
| Drosophila melanogaster | 0.000025 | mg/mL | 55.98 | 55.86 | 0 | NS | 31137639 | Inactive | |||||
| Drosophila melanogaster | 0.25 | mg/mL | 55.98 | 52.66 | -0.06 | NS | 31137639 | Inactive | |||||
| Drosophila melanogaster | 0.0025 | mg/mL | 55.98 | 57.07 | 0.02 | NS | 31137639 | Inactive | |||||
| Drosophila melanogaster | 0.00025 | mg/mL | 55.98 | 52.53 | -0.06 | NS | 31137639 | Inactive | |||||
| Drosophila melanogaster | 0.0000025 | mg/mL | 55.98 | 55.02 | -0.02 | NS | 31137639 | Inactive | |||||
| Caenorhabditis elegans | 50 | ppm | 16 | 16 | 0 | Unclear | 19837596 |
Experimental Data Visualization
riboflavin
Statistics Data
riboflavin
| Species | Lifespan Change(AVG/MED%) | Lifespan Change(MAX%) | Count Reference | Count Data point |
|---|---|---|---|---|
| Caenorhabditis elegans | 0 | 1 | 1 | |
| Drosophila melanogaster | 0.02 | 1 | 6 |
Statistics Data Visualization
riboflavin
