Compound Summary
Compound Information
phenylbutazone
Compound Name: | phenylbutazone |
Compound CID: | 4781 |
Synonyms: | phenylbutazone 50-33-9 4-Butyl-1,2-diphenylpyrazolidine-3,5-dione Butazolidine Fenilbutazona More... |
Iupac Name: | 4-butyl-1,2-diphenylpyrazolidine-3,5-dione |
InChI: | InChI=1S/C19H20N2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16/h4-13,17H,2-3,14H2,1H3 |
InChIKey: | VYMDGNCVAMGZFE-UHFFFAOYSA-N |
Canonical Smiles: | CCCCC1C(=O)N(N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3 |
Isomeric Smiles: | CCCCC1C(=O)N(N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3 |
Molecular Weight: | 308.4 |
Molecular Formula: | C19H20N2O2 |
Compound Structure
2D Structure:
3D Structure:
Computed Properties
phenylbutazone
Molecular Weight: | 308.4 |
Molecular Formula: | C19H20N2O2 |
Hydrogen Bond Donor Count: | 0 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 5 |
Heavy Atom Count: | 23 |
Complexity: | 389 |
Synonyms
phenylbutazone
| phenylbutazone | phenylbutazone |
|---|---|
phenylbutazone |
50-33-9 |
4-Butyl-1,2-diphenylpyrazolidine-3,5-dione |
Butazolidine |
Fenilbutazona |
Butazolidin |
Diphenylbutazone |
Phenylbutazonum |
Butapirazol |
Butapyrazole |
Butacote |
Butadion |
Azolid |
Bute |
Alkabutazona |
Butapirazole |
Chembutazone |
Fenibutazona |
Fenylbutazon |
Intrabutazone |
Mephabutazon |
Mephabutazone |
Phenylbutazon |
Praecirheumin |
Scanbutazone |
Alqoverin |
Anpuzone |
Anuspiramin |
Arthrizon |
Artrizin |
Artrizone |
Artropan |
Azobutyl |
Bunetzone |
Butacompren |
Butadiona |
Butagesic |
Butalgina |
Butalidon |
Butarecbon |
Butartril |
Butartrina |
Butazina |
Butazona |
Butidiona |
Butylpyrin |
Buvetzone |
Digibutina |
Diossidone |
Diphebuzol |
Ecobutazone |
Eributazone |
Febuzina |
Fenartil |
Fenibutal |
Fenibutasan |
Fenibutol |
Fenilbutina |
Fenilbutine |
Fenilidina |
Fenotone |
Intalbut |
Intrazone |
Ipsoflame |
Malgesic |
Merizone |
Nadazone |
Nadozone |
Novophenyl |
Phebuzin |
Phebuzine |
Phenbutazol |
Phenopyrine |
Phenylbutaz |
Phenyzone |
Pyrabutol |
Pyrazolidin |
Rectofasa |
Reumasyl |
Reumazin |
Reumazol |
Reumuzol |
Reupolar |
Robizone |
Rubatone |
Alindor |
Anerval |
Antadol |
Benzone |
Betazed |
Busone |
Butaluy |
Butone |
Diozol |
Elmedal |
Lingel |
Reudox |
Reumune |
Butoz |
Buzon |
Kadol |
Reudo |
Butiwas-Simple |
Neo-zoline |
Phenyl-Mobuzon |
Equi bute |
Robizon-V |
Butaphen |
Equipalazone |
Flexazone |
4-Butyl-1,2-diphenyl-3,5-pyrazolidinedione |
Ia-But |
Pirarreumol B |
Buta phen |
Bizolin 200 |
Phenbutazone |
Schemergin |
Wescozone |
Zolaphen |
Azdid |
Tazone |
Uzone |
Phen-Buta-Vet |
4-Butyl-1,2-diphenyl-3,5-dioxopyrazolidine |
Shigrodin |
Tencodyne |
Tevcodyne |
Therazone |
Todalgil |
Zolidinum |
Tetnor |
Ticinil |
B.t.z. |
3,5-Pyrazolidinedione, 4-butyl-1,2-diphenyl- |
4-BUTYL-1,2-DIPHENYL-PYRAZOLIDINE-3,5-DIONE |
Phenyl butazone |
Usaf ge-15 |
4-n-Butyl-1,2-diphenyl-3,5-pyrazolidinedione |
3,5-Dioxo-1,2-diphenyl-4-N-butylpyrazolidine |
VAC-10 |
A 7514 |
DA-192 |
1,2-Diphenyl-4-butyl-3,5-pyrazolidinedione |
3,5-Dioxo-1,2-diphenyl-4-n-butyl-pyrazolidin |
G 13,871 |
UNII-GN5P7K3T8S |
1,2-Diphenyl-3,5-dioxo-4-butylpyrazolidine |
1,2-Diphenyl-4-butyl-3,5-dioxopyrazolidine |
R-3-ZON |
CHEBI:48574 |
Fenilbutazon |
Bizolin |
Exrheudon N |
Robizone-V |
GN5P7K3T8S |
50-33-9 (free form) |
MLS000069424 |
Butadionum |
Schemergen |
NCI-C55414 |
MFCD00005500 |
esteve |
NCGC00015846-10 |
NCGC00015846-11 |
Fenilbutazone |
Butatron |
SMR000059073 |
Fenilbutazone DCIT |
Phenylbutazon German |
DSSTox_CID_1136 |
DSSTox_RID_75967 |
DSSTox_GSID_21136 |
P1Z |
Fenilbutazona INN-Spanish |
Phenylbutazonum INN-Latin |
CAS-50-33-9 |
CCRIS 2374 |
component of Azolid-A |
HSDB 3159 |
3,5-Dioxe-4 buty-1, diphenyl-pyrazolidine |
NCI-C56531 |
4-butyl-1,2-diphenyl-1,2-diazolidine-3,5-dione |
SR-01000000004 |
AZOLID (TN) |
EINECS 200-029-0 |
NSC 25134 |
G 13871 |
BRN 0290080 |
Alkazone |
Phenogel |
Phen-Buta |
Pirarreumol B |
Phenylbutazone USP:INN:BAN:JAN |
1,5-dioxopyrazolidine |
Spectrum_001079 |
4-Butyl-1,5-dione |
Opera_ID_888 |
Spectrum2_001282 |
Spectrum3_000675 |
Spectrum4_000477 |
Spectrum5_001335 |
Lopac-P-8386 |
P1686 |
Epitope ID:124940 |
P 8386 |
SCHEMBL3632 |
Lopac0_000993 |
Oprea1_416494 |
BSPBio_002369 |
KBioGR_000954 |
KBioSS_001559 |
MLS001148412 |
MLS002152929 |
DivK1c_000331 |
SPECTRUM1500482 |
SPBio_001283 |
1,5-dioxo-4-butylpyrazolidine |
3, 4-butyl-1,2-diphenyl- |
4-Butyl-1,5-dioxopyrazolidine |
4-Butyl-1,5-pyrazolidinedione |
GTPL7270 |
1,3-dioxo-4-N-butylpyrazoline |
DTXSID9021136 |
HMS501A13 |
KBio1_000331 |
KBio2_001559 |
KBio2_004127 |
KBio2_006695 |
KBio3_001589 |
NINDS_000331 |
Phenylbutazone (JP17/USP/INN) |
BCPP000108 |
HMS1920H06 |
HMS2090H17 |
HMS2091P08 |
HMS2233B13 |
HMS3263G07 |
HMS3369P16 |
HMS3649M17 |
HMS3651G15 |
HMS3715E21 |
HMS3884C06 |
Pharmakon1600-01500482 |
Phenylbutazone, analytical standard |
Phenylbutazone-d10(diphenyl-d10) |
component of Azolid-A (Salt/Mix) |
BCP02607 |
HY-B0230 |
NSC25134 |
3,2-diphenyl-4-N-butylpyrazolidine |
Tox21_110242 |
Tox21_110243 |
Tox21_201809 |
Tox21_302763 |
Tox21_500993 |
3,2-diphenyl-4-N-butyl-pyrazolidin |
AC-683 |
CCG-39220 |
NSC-25134 |
NSC757272 |
s1654 |
SBB012526 |
STK388348 |
AKOS001592731 |
Phenylbutazone (Butazolidin, Butatron) |
Tox21_110242_1 |
ZINC100004227 |
DB00812 |
KS-5127 |
LP00993 |
MCULE-4303869118 |
NSC-757272 |
SDCCGSBI-0050966.P005 |
WLN: T5VNNV EHJ BR& CR& E4 |
IDI1_000331 |
NCGC00015846-01 |
NCGC00015846-02 |
NCGC00015846-03 |
NCGC00015846-04 |
NCGC00015846-05 |
NCGC00015846-06 |
NCGC00015846-07 |
NCGC00015846-08 |
NCGC00015846-09 |
NCGC00015846-12 |
NCGC00015846-13 |
NCGC00015846-15 |
NCGC00015846-27 |
NCGC00023855-03 |
NCGC00023855-04 |
NCGC00023855-05 |
NCGC00023855-06 |
NCGC00023855-07 |
NCGC00023855-08 |
NCGC00181112-01 |
NCGC00256449-01 |
NCGC00259358-01 |
NCGC00261678-01 |
4297-92-1 |
BP166190 |
ST066897 |
SBI-0050966.P004 |
DB-051755 |
EU-0100993 |
FT-0603217 |
SW199456-2 |
UNM000001255503 |
1,2-diphenyl-3,5-dioxo-4-butyl-pyrazolidine |
Phenylbutazone, SAJ special grade, >=99.0% |
1,2-diphenyl-3,5-dioxo-4-n-butylpyrazolidine |
C07440 |
D00510 |
1,2-diphenyl-3,5-dioxo-4-n-butyl-pyrazolidine |
AB00052071-15 |
AB00052071-16 |
AB00052071_17 |
AB00052071_18 |
A828072 |
AG-205/04675049 |
Q421342 |
SR-01000000004-2 |
SR-01000000004-4 |
SR-01000000004-5 |
SR-01000000004-9 |
W-105972 |
BRD-K10843433-001-12-8 |
BRD-K10843433-001-20-1 |
SR-01000000004-13 |
Z57355370 |
4-butyl-1,2-diphenyl-1H-pyrazole-3,5(2H,4H)-dione |
Phenylbutazone, TraceCERT(R), certified reference material |
Phenylbutazone, European Pharmacopoeia (EP) Reference Standard |
Phenylbutazone, United States Pharmacopeia (USP) Reference Standard |
Experimental Data
phenylbutazone
| Species | Dosage | Unit | CG Lifespan(AVG/MED days) | TG Lifespan(AVG/MED days) | Lifespan Change(AVG/MED%) | CG Lifespan(MAX days) | TG Lifespan(MAX days) | Lifespan Change(MAX%) | Significant | Strain | Gender | PubMed | Active Label |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Caenorhabditis elegans | 33 | umol/L | -11 | NS | N2 | 24134630 | Inactive |
Experimental Data Visualization
phenylbutazone
Statistics Data
phenylbutazone
| Species | Lifespan Change(AVG/MED%) | Lifespan Change(MAX%) | Count Reference | Count Data point |
|---|---|---|---|---|
| Caenorhabditis elegans | -11 | 1 | 1 |
Statistics Data Visualization
phenylbutazone
