Compound Summary
Compound Information
captopril
Compound Name: | captopril |
Compound CID: | 44093 |
Synonyms: | captopril 62571-86-2 Capoten L-Captopril Lopirin More... |
Iupac Name: | (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid |
InChI: | InChI=1S/C9H15NO3S/c1-6(5-14)8(11)10-4-2-3-7(10)9(12)13/h6-7,14H,2-5H2,1H3,(H,12,13)/t6-,7+/m1/s1 |
InChIKey: | FAKRSMQSSFJEIM-RQJHMYQMSA-N |
Canonical Smiles: | CC(CS)C(=O)N1CCCC1C(=O)O |
Isomeric Smiles: | C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O |
Molecular Weight: | 217.29 |
Molecular Formula: | C9H15NO3S |
Compound Structure
2D Structure:
3D Structure:
Computed Properties
captopril
Molecular Weight: | 217.29 |
Molecular Formula: | C9H15NO3S |
Hydrogen Bond Donor Count: | 2 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
Heavy Atom Count: | 14 |
Complexity: | 244 |
Synonyms
captopril
| captopril | captopril |
|---|---|
captopril |
62571-86-2 |
Capoten |
L-Captopril |
Lopirin |
Captopryl |
Cesplon |
Captolane |
Tensoprel |
Acepress |
Captoril |
Dilabar |
Garranil |
Hypertil |
Tenosbon |
Alopresin |
Acepril |
Lopril |
Captoprilum |
Acediur |
Aceplus |
(2S)-1-(2S)-2-methyl-3-sulfanylpropanoylpyrrolidine-2-carboxylic acid |
Tensobon |
Apopril |
Captoprilum INN-Latin |
SQ 14225 |
SQ-14225 |
D-2-Methyl-3-mercaptopropanoyl-L-proline |
D-3-Mercapto-2-methylpropanoyl-L-proline |
SQ 14,225 |
1-((2S)-3-Mercapto-2-methylpropionyl)-L-proline |
SA 333 |
D-3-Mercapto-2-methylpropionylproline |
1-(2S)-2-methyl-3-sulfanylpropanoyl-L-proline |
(2S)-1-(3-Mercapto-2-methylpropionyl)-L-proline |
UNII-9G64RSX1XD |
Hipertil |
L-Proline, 1-(2S)-3-mercapto-2-methyl-1-oxopropyl- |
CHEBI:3380 |
L-Proline, 1-(3-mercapto-2-methyl-1-oxopropyl)-, (S)- |
9G64RSX1XD |
CHEMBL1560 |
1-(2S)-3-Mercapto-2-methyl-1-oxopropyl-L-proline |
MLS000069484 |
Asisten |
Isopresol |
(-)-Captopril |
C9H15NO3S |
2S-1-3-Mercapto-2-methylpropionyl-L-proline |
1-(3-Mercapto-2-methyl-1-oxopropyl)-L-proline |
MFCD00168073 |
SQ-14534 |
(S)-1-(3-Mercapto-2-methyl-1-oxopropyl)-L-proline |
NCGC00023654-04 |
SMR000059061 |
Lopirin Switzerland |
(S)-1-((S)-3-mercapto-2-methylpropanoyl)pyrrolidine-2-carboxylic acid |
1-Pyrrolidinecarboxylic acid, 1-(D-3-mercapto-2-methyl-1-propionyl)-, L-(S,S)- |
DSSTox_CID_17197 |
DSSTox_RID_79306 |
DSSTox_GSID_37197 |
L-Proline, 1-((2S)-3-mercapto-2-methyl-1-oxopropyl)- |
Novocaptopril |
Captril |
Farcopril |
Hypopress |
Tensiomin |
Zapto |
Captopril (Capoten) |
Capozide (Salt/Mix) |
3-Mercapto-2-methylpropionyl-proline |
X8Z |
Apopril (TN) |
Capoten (TN) |
HSDB 6527 |
1-(2s)-3-mercapto-2-methylpropionyl-l-proline |
SR-01000075603 |
EINECS 263-607-1 |
component of Captea (Salt/Mix) |
component of Acezide (Salt/Mix) |
component of Ecazide (Salt/Mix) |
1-(D-3-Mercapto-2-methyl-1-oxopropyl)-L-proline (S,S) |
(2S)-1-((2S)-2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid |
C09AA01 |
Captopril,(S) |
Prestwick_103 |
Captopril USAN:USP:INN:BAN:JAN |
SQ14534 |
SCHEMBL4 |
Spectrum_000688 |
1-(D-3-Mercapto-2-methyl-1-oxopropyl)-L-proline |
Opera_ID_1041 |
Prestwick3_000019 |
Spectrum2_001211 |
Spectrum3_001388 |
Spectrum4_000811 |
Spectrum5_001587 |
Lopac-C-4042 |
1-((2S)-2-Methyl-3-sulfanylpropanoyl)-L-proline # |
Epitope ID:114065 |
UPCMLD-DP003 |
C 4042 |
Lopac0_000302 |
N-(S)-3-Mercapto-2-methylpropionyl-L-proline |
BSPBio_000057 |
BSPBio_002976 |
KBioGR_001321 |
KBioSS_001168 |
MLS001076488 |
DivK1c_000208 |
SPECTRUM1500682 |
SPBio_001022 |
Captopril (JP17/USP/INN) |
(S)-1-(3-Mercapto-2-methyl-1-oxo-propyl)-L-proline |
BPBio1_000063 |
GTPL5158 |
DTXSID1037197 |
UPCMLD-DP003:001 |
BDBM21642 |
HMS500K10 |
KBio1_000208 |
KBio2_001168 |
KBio2_003736 |
KBio2_006304 |
KBio3_002196 |
ZINC57001 |
1j37 |
NINDS_000208 |
HMS1921C12 |
HMS2089P19 |
HMS2092I12 |
HMS2095C19 |
HMS2233I04 |
HMS3259G10 |
HMS3260N06 |
HMS3712C19 |
Pharmakon1600-01500682 |
SA333 |
HY-B0368 |
Tox21_110890 |
Tox21_500302 |
BBL033600 |
CCG-39104 |
EI-213 |
NSC757419 |
s2051 |
SA-333 |
SBB017523 |
STK802012 |
AKOS005622581 |
Captopril, >=98% (HPLC), powder |
Tox21_110890_1 |
BCP9000485 |
CS-2425 |
DB01197 |
KS-5025 |
LP00302 |
MCULE-1716939647 |
NC00554 |
NSC 757419 |
NSC-757419 |
SDCCGSBI-0050290.P006 |
IDI1_000208 |
SMP1_000056 |
NCGC00015235-01 |
NCGC00015235-02 |
NCGC00023654-03 |
NCGC00023654-05 |
NCGC00023654-06 |
NCGC00023654-07 |
NCGC00023654-08 |
NCGC00023654-09 |
NCGC00023654-10 |
NCGC00023654-11 |
NCGC00023654-13 |
NCGC00023654-25 |
NCGC00023654-26 |
NCGC00260987-01 |
AC-12047 |
AC-32120 |
ST079562 |
SBI-0050290.P004 |
AB0007072 |
Captopril, meets USP testing specifications |
SQ -14225 |
EU-0100302 |
((S)-3-mercapto-2-methylpropanoyl)-L-proline |
BIM-0050290.0001 |
C06867 |
D00251 |
J10167 |
54254-EP2269989A1 |
54254-EP2270011A1 |
54254-EP2272841A1 |
54254-EP2277879A1 |
54254-EP2287165A2 |
54254-EP2287166A2 |
54254-EP2292620A2 |
54254-EP2295406A1 |
54254-EP2298742A1 |
54254-EP2298772A1 |
54254-EP2298776A1 |
54254-EP2298779A1 |
54254-EP2301923A1 |
54254-EP2301931A1 |
54254-EP2301936A1 |
54254-EP2305219A1 |
54254-EP2305648A1 |
54254-EP2308562A2 |
54254-EP2308839A1 |
AB00052156-16 |
AB00052156_17 |
AB00052156_18 |
571C862 |
Q421119 |
SR-01000000039 |
1-(2S)-3-Mercapto-2-methylpropionyl- L-proline |
SR-01000000039-2 |
SR-01000075603-1 |
SR-01000075603-3 |
1-(S)-3-mercapto-2-methyl-1-oxopropyl-L-proline |
BRD-K54529596-001-04-0 |
BRD-K54529596-001-15-6 |
Captopril, British Pharmacopoeia (BP) Reference Standard |
Z2786051697 |
Captopril, European Pharmacopoeia (EP) Reference Standard |
Captopril, United States Pharmacopeia (USP) Reference Standard |
Captopril, Pharmaceutical Secondary Standard; Certified Reference Material |
L-?Proline, 1-?(2S)?-?3-?mercapto-?2-?methyl-?1-?oxopropyl?- |
Captopril for system suitability, European Pharmacopoeia (EP) Reference Standard |
Experimental Data
captopril
| Species | Dosage | Unit | CG Lifespan(AVG/MED days) | TG Lifespan(AVG/MED days) | Lifespan Change(AVG/MED%) | CG Lifespan(MAX days) | TG Lifespan(MAX days) | Lifespan Change(MAX%) | Significant | Strain | Gender | PubMed | Active Label |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Caenorhabditis elegans | 2.54 | mM | 15.9 | 21.4 | 34 | 24.9 | 29.4 | 16 | NS | N2 | 26918946 | Inactive | |
| Caenorhabditis elegans | 3.18 | mM | 15.9 | 18.4 | 18 | 24.9 | 26.2 | 5 | S | N2 | 26918946 | Active | |
| Caenorhabditis elegans | 2.54 | mM | 16.2 | 19.6 | 23 | 23 | 29.8 | 18 | S | N2 | 26918946 | Active | |
| Caenorhabditis elegans | 1.9 | mM | 15.9 | 17.7 | 11 | 24.9 | 27.9 | 11 | S | N2 | 26918946 | Active | |
| Caenorhabditis elegans | 33 | umol/L | 3 | NS | N2 | 24134630 | Inactive |
Experimental Data Visualization
captopril
Statistics Data
captopril
| Species | Lifespan Change(AVG/MED%) | Lifespan Change(MAX%) | Count Reference | Count Data point |
|---|---|---|---|---|
| Caenorhabditis elegans | 34 | 18 | 2 | 5 |
Statistics Data Visualization
captopril
