Compound Summary
Compound Name: | 67423-45-4 |
Compound CID: | 2723890 |
Synonyms: | 67423-45-4 4-Hydroxy-3-methoxyphenylglycol hemipiperazinium salt 1-(4-hydroxy-3-methoxyphenyl)ethane-1,2-diol;piperazine DL-4-Hydroxy-3-methoxyphenylglycol piperazine salt EINECS 266-689-7 More... |
Iupac Name: | 1-(4-hydroxy-3-methoxyphenyl)ethane-1,2-diol;piperazine |
InChI: | InChI=1S/2C9H12O4.C4H10N2/c2*1-13-9-4-6(8(12)5-10)2-3-7(9)11;1-2-6-4-3-5-1/h2*2-4,8,10-12H,5H2,1H3;5-6H,1-4H2 |
InChIKey: | KCECBJRHWSOTMR-UHFFFAOYSA-N |
Canonical Smiles: | COC1=C(C=CC(=C1)C(CO)O)O.COC1=C(C=CC(=C1)C(CO)O)O.C1CNCCN1 |
Isomeric Smiles: | COC1=C(C=CC(=C1)C(CO)O)O.COC1=C(C=CC(=C1)C(CO)O)O.C1CNCCN1 |
Molecular Weight: | 454.5 |
Molecular Formula: | C22H34N2O8 |
Molecular Weight: | 454.5 |
Molecular Formula: | C22H34N2O8 |
Hydrogen Bond Donor Count: | 8 |
Hydrogen Bond Acceptor Count: | 10 |
Rotatable Bond Count: | 6 |
Heavy Atom Count: | 32 |
Complexity: | 177 |
| 67423-45-4 | 67423-45-4 |
|---|---|
67423-45-4 |
4-Hydroxy-3-methoxyphenylglycol hemipiperazinium salt |
1-(4-hydroxy-3-methoxyphenyl)ethane-1,2-diol;piperazine |
DL-4-Hydroxy-3-methoxyphenylglycol piperazine salt |
EINECS 266-689-7 |
3-Methoxy-4-hydroxy-phenylglycol piperazine |
CHEMBL1593209 |
DTXSID701016938 |
HMS3261B08 |
DL-4-Hydroxy-3-methoxyphenylethyleneglycol - piperazine (2:1) |
Tox21_500563 |
MFCD00065957 |
CCG-204653 |
LP00563 |
NCGC00093948-01 |
NCGC00261248-01 |
DB-055028 |
EU-0100563 |
FT-0641125 |
1-(4-Hydroxy-3-methoxyphenyl)-1,2-ethanediol compd. with piperazine (2:1) |
4-Hydroxy-3-methoxyphenylglycol hemipiperazinium salt, >=98.0% (HPLC) |
1-(4-hydroxy-3-methoxyphenyl)ethane-1,2-diol compound with piperazine (2:1) |
| Species | Dosage | Unit | CG Lifespan(AVG/MED days) | TG Lifespan(AVG/MED days) | Lifespan Change(AVG/MED%) | CG Lifespan(MAX days) | TG Lifespan(MAX days) | Lifespan Change(MAX%) | Significant | Strain | Gender | PubMed | Active Label |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Caenorhabditis elegans | 33 | umol/L | 11 | NS | N2 | 24134630 | Inactive |
| Species | Lifespan Change(AVG/MED%) | Lifespan Change(MAX%) | Count Reference | Count Data point |
|---|---|---|---|---|
| Caenorhabditis elegans | 11 | 1 | 1 |