Compound Summary
Compound Information
Tilarginine Acetate
Compound Name: | Tilarginine Acetate |
Compound CID: | 135242 |
Synonyms: | Tilarginine Acetate 53308-83-1 L-NMMA acetate L-NMMA NG-Monomethyl-L-arginine acetate More... |
Iupac Name: | acetic acid;(2S)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoic acid |
InChI: | InChI=1S/C7H16N4O2.C2H4O2/c1-10-7(9)11-4-2-3-5(8)6(12)13;1-2(3)4/h5H,2-4,8H2,1H3,(H,12,13)(H3,9,10,11);1H3,(H,3,4)/t5-;/m0./s1 |
InChIKey: | IKPNWIGTWUZCKM-JEDNCBNOSA-N |
Canonical Smiles: | CC(=O)O.CN=C(N)NCCCC(C(=O)O)N |
Isomeric Smiles: | CC(=O)O.CN=C(N)NCCC[C@@H](C(=O)O)N |
Molecular Weight: | 248.28 |
Molecular Formula: | C9H20N4O4 |
Compound Structure
2D Structure:
3D Structure:
Computed Properties
Tilarginine Acetate
Molecular Weight: | 248.28 |
Molecular Formula: | C9H20N4O4 |
Hydrogen Bond Donor Count: | 5 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 6 |
Heavy Atom Count: | 17 |
Complexity: | 224 |
Synonyms
Tilarginine Acetate
| Tilarginine Acetate | Tilarginine Acetate |
|---|---|
Tilarginine Acetate |
53308-83-1 |
L-NMMA acetate |
L-NMMA |
NG-Monomethyl-L-arginine acetate |
UNII-2FL3530AF2 |
L-NMMA (acetate) |
Tilarginine acetate USAN |
2FL3530AF2 |
NG-Methyl-L-arginine acetate salt |
ANO-1020 |
L-Ornithine, N5-imino(methylamino)methyl-CAS |
MFCD00069311 |
N-Omega-monomethyl-L-arginine acetate |
(E)-Nw-methyl-L-arginine compound with acetic acid (1:1) |
17035-90-4 |
Tilarginine acetate (USAN) |
DSSTox_CID_25780 |
DSSTox_RID_81122 |
DSSTox_GSID_45780 |
Nomega-Me-L-Arg |
SMR000449329 |
CAS-53308-83-1 |
NCGC00024780-01 |
NCGC00024780-04 |
NG-Me-L-Arg, AcOH |
NG-MONOMETHYL-L-ARGININEACETATE |
N(G)-Methyl-L-arginine acetate |
NCGC00094091-01 |
ANO 1020 |
Nomega-Monomethyl-L-arginine Acetate |
Methylarginine acetate |
Ng-methylarginine acetate |
NG-Monomethyl-L-arginine, Monoacetate Salt |
H-Arg(Me)-OH.AcOH |
MLS000758278 |
MLS001401412 |
MLS002172472 |
N5-(Imino(methylamino)methyl)-L-ornithine monoacetate |
SCHEMBL1321022 |
acetic acid;(2S)-2-amino-5-(N-methylcarbamimidoyl)aminopentanoic acid |
C7H16N4O2.CH3CO2H |
CHEMBL1256175 |
DTXSID7045780 |
C9H20N4O4 |
Nomega-Methyl-L-arginine Acetate |
L-Ornithine, N5-(imino(methylamino)methyl)-, monoacetate |
HMS2051M15 |
HMS2235N20 |
HMS3262E22 |
Tox21_111246 |
Tox21_113520 |
Tox21_113578 |
Tox21_500750 |
HY-18732A |
s7920 |
N/omega-Monomethyl-L-arginine acetate |
Nomega-Methyl-L-arginine acetate salt |
AKOS024458640 |
NG-Monomethyl-L-arginine acetate salt |
CCG-100805 |
CCG-222054 |
LP00750 |
NC00055 |
N(omega)-Monomethyl-L-Arginine Acetate |
NCGC00261435-01 |
B6444 |
CS-0014213 |
EU-0100750 |
M1365 |
N5-(Methylamidino)-L-ornithine acetate salt |
X4986 |
D09018 |
D91492 |
M 7033 |
SR-01000597858 |
NG-Methyl-L-arginine acetate salt, >=98% (TLC) |
SR-01000597858-1 |
Q27254685 |
(2S)-2-Amino-5-((methylcarbamimidoyl)amino)pentanoic acid monoacetate |
(S)-2-amino-5-(3-methylguanidino)pentanoic acid compound with acetic acid (1:1) |
Experimental Data
Tilarginine Acetate
| Species | Dosage | Unit | CG Lifespan(AVG/MED days) | TG Lifespan(AVG/MED days) | Lifespan Change(AVG/MED%) | CG Lifespan(MAX days) | TG Lifespan(MAX days) | Lifespan Change(MAX%) | Significant | Strain | Gender | PubMed | Active Label |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Caenorhabditis elegans | 33 | umol/L | 1 | NS | N2 | 24134630 | Inactive |
Experimental Data Visualization
Tilarginine Acetate
Statistics Data
Tilarginine Acetate
| Species | Lifespan Change(AVG/MED%) | Lifespan Change(MAX%) | Count Reference | Count Data point |
|---|---|---|---|---|
| Caenorhabditis elegans | 1 | 1 | 1 |
Statistics Data Visualization
Tilarginine Acetate
